|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
B3PW91/cc-pVDZ
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1847 |
|
0.1847 |
0.0000 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.3977 |
|
1.3977 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2870 |
-0.6125 |
|
-0.6125 |
0.0000 |
1.2870 |
| C4 |
0.0000 |
-1.2870 |
-0.6125 |
|
-0.6125 |
0.0000 |
-1.2870 |
| H5 |
0.0000 |
2.1479 |
0.0677 |
|
0.0677 |
0.0000 |
2.1479 |
| H6 |
0.0000 |
-2.1479 |
0.0677 |
|
0.0677 |
0.0000 |
-2.1479 |
| H7 |
0.8846 |
1.3321 |
-1.2689 |
|
-1.2689 |
0.8846 |
1.3321 |
| H8 |
-0.8846 |
1.3321 |
-1.2689 |
|
-1.2689 |
-0.8846 |
1.3321 |
| H9 |
-0.8846 |
-1.3321 |
-1.2689 |
|
-1.2689 |
-0.8846 |
-1.3321 |
| H10 |
0.8846 |
-1.3321 |
-1.2689 |
|
-1.2689 |
0.8846 |
-1.3321 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2130 |
1.5139 |
1.5139 |
2.1511 |
2.1511 |
2.1611 |
2.1611 |
2.1611 |
2.1611 |
| O2 |
1.2130 |
| 2.3869 |
2.3869 |
2.5263 |
2.5263 |
3.1094 |
3.1094 |
3.1094 |
3.1094 |
| C3 |
1.5139 |
2.3869 |
| 2.5740 |
1.0972 |
3.5016 |
1.1025 |
1.1025 |
2.8414 |
2.8414 |
| C4 |
1.5139 |
2.3869 |
2.5740 |
| 3.5016 |
1.0972 |
2.8414 |
2.8414 |
1.1025 |
1.1025 |
| H5 |
2.1511 |
2.5263 |
1.0972 |
3.5016 |
| 4.2958 |
1.7985 |
1.7985 |
3.8314 |
3.8314 |
| H6 |
2.1511 |
2.5263 |
3.5016 |
1.0972 |
4.2958 |
| 3.8314 |
3.8314 |
1.7985 |
1.7985 |
| H7 |
2.1611 |
3.1094 |
1.1025 |
2.8414 |
1.7985 |
3.8314 |
| 1.7693 |
3.1982 |
2.6642 |
| H8 |
2.1611 |
3.1094 |
1.1025 |
2.8414 |
1.7985 |
3.8314 |
1.7693 |
| 2.6642 |
3.1982 |
| H9 |
2.1611 |
3.1094 |
2.8414 |
1.1025 |
3.8314 |
1.7985 |
3.1982 |
2.6642 |
| 1.7693 |
| H10 |
2.1611 |
3.1094 |
2.8414 |
1.1025 |
3.8314 |
1.7985 |
2.6642 |
3.1982 |
1.7693 |
|
Maximum atom distance is 4.2958Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.776 |
|
O2 |
C1 |
C4 |
121.776 |
|
C3 |
C1 |
C4 |
116.448 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.908 |
|
C1 |
C3 |
H7 |
110.383 |
|
C1 |
C3 |
H8 |
110.383 |
|
C1 |
C4 |
H6 |
109.908 |
|
C1 |
C4 |
H9 |
110.383 |
|
C1 |
C4 |
H10 |
110.383 |
|
H5 |
C3 |
H7 |
109.697 |
|
H5 |
C3 |
H8 |
109.697 |
|
H6 |
C4 |
H9 |
109.697 |
|
H6 |
C4 |
H10 |
109.697 |
|
H7 |
C3 |
H8 |
106.719 |
|
H9 |
C4 |
H10 |
106.719 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.