|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHClCH3 (Propane, 2-chloro-)
1A' CS
1910171554
InChI=1S/C3H7Cl/c1-3(2)4/h3H,1-2H3 INChIKey=ULYZAYCEDJDHCC-UHFFFAOYSA-N
B3LYP/cc-pVDZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| Cl1 |
-0.9008 |
1.0280 |
0.0000 |
|
1.3661 |
0.0000 |
-0.0445 |
| C2 |
0.5770 |
-0.0771 |
0.0000 |
|
-0.4255 |
0.0000 |
0.3972 |
| C3 |
0.5770 |
-0.9076 |
1.2745 |
|
-1.0677 |
1.2745 |
-0.1295 |
| C4 |
0.5770 |
-0.9076 |
-1.2745 |
|
-1.0677 |
-1.2745 |
-0.1295 |
| H5 |
1.4235 |
0.6251 |
0.0000 |
|
-0.4195 |
0.0000 |
1.4971 |
| H6 |
1.4873 |
-1.5310 |
1.3061 |
|
-2.1270 |
1.3061 |
0.1790 |
| H7 |
1.4873 |
-1.5310 |
-1.3061 |
|
-2.1270 |
-1.3061 |
0.1790 |
| H8 |
0.5646 |
-0.2684 |
2.1692 |
|
-0.5656 |
2.1692 |
0.2663 |
| H9 |
0.5646 |
-0.2684 |
-2.1692 |
|
-0.5656 |
-2.1692 |
0.2663 |
| H10 |
-0.2995 |
-1.5738 |
1.3096 |
|
-1.0269 |
1.3096 |
-1.2297 |
| H11 |
-0.2995 |
-1.5738 |
-1.3096 |
|
-1.0269 |
-1.3096 |
-1.2297 |
Atom - Atom Distances (Å)
| |
Cl1 |
C2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| Cl1 |
| 1.8453 |
2.7486 |
2.7486 |
2.3590 |
3.7360 |
3.7360 |
2.9212 |
2.9212 |
2.9742 |
2.9742 |
| C2 |
1.8453 |
|
1.5212 |
1.5212 |
1.0999 |
2.1560 |
2.1560 |
2.1776 |
2.1776 |
2.1733 |
2.1733 |
| C3 |
2.7486 |
1.5212 |
| 2.5491 |
2.1658 |
1.1038 |
2.8066 |
1.0996 |
3.5025 |
1.1015 |
2.8089 |
| C4 |
2.7486 |
1.5212 |
2.5491 |
| 2.1658 |
2.8066 |
1.1038 |
3.5025 |
1.0996 |
2.8089 |
1.1015 |
| H5 |
2.3590 |
1.0999 |
2.1658 |
2.1658 |
| 2.5217 |
2.5217 |
2.4983 |
2.4983 |
3.0853 |
3.0853 |
| H6 |
3.7360 |
2.1560 |
1.1038 |
2.8066 |
2.5217 |
| 2.6121 |
1.7862 |
3.8109 |
1.7874 |
3.1680 |
| H7 |
3.7360 |
2.1560 |
2.8066 |
1.1038 |
2.5217 |
2.6121 |
| 3.8109 |
1.7862 |
3.1680 |
1.7874 |
| H8 |
2.9212 |
2.1776 |
1.0996 |
3.5025 |
2.4983 |
1.7862 |
3.8109 |
| 4.3383 |
1.7859 |
3.8148 |
| H9 |
2.9212 |
2.1776 |
3.5025 |
1.0996 |
2.4983 |
3.8109 |
1.7862 |
4.3383 |
| 3.8148 |
1.7859 |
| H10 |
2.9742 |
2.1733 |
1.1015 |
2.8089 |
3.0853 |
1.7874 |
3.1680 |
1.7859 |
3.8148 |
| 2.6192 |
| H11 |
2.9742 |
2.1733 |
2.8089 |
1.1015 |
3.0853 |
3.1680 |
1.7874 |
3.8148 |
1.7859 |
2.6192 |
|
Maximum atom distance is 4.3383Å
between atoms H8 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Cl1 |
C2 |
C3 |
109.084 |
|
Cl1 |
C2 |
C4 |
109.084 |
|
C3 |
C2 |
C4 |
113.821 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Cl1 |
C3 |
H5 |
55.867 |
|
C2 |
C3 |
H6 |
109.406 |
|
C2 |
C3 |
H8 |
111.362 |
|
C2 |
C3 |
H10 |
110.909 |
|
C2 |
C4 |
H7 |
109.406 |
|
C2 |
C4 |
H9 |
111.362 |
|
C2 |
C4 |
H11 |
110.909 |
|
C3 |
C2 |
H5 |
110.399 |
|
C4 |
C2 |
H5 |
110.399 |
|
H6 |
C3 |
H8 |
108.321 |
|
H6 |
C3 |
H10 |
108.291 |
|
H7 |
C4 |
H9 |
108.321 |
|
H7 |
C4 |
H11 |
108.291 |
|
H8 |
C3 |
H10 |
108.464 |
|
H9 |
C4 |
H11 |
108.464 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.