|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
MP2/cc-pVDZ
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1867 |
|
0.1867 |
-0.0001 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4095 |
|
1.4095 |
-0.0010 |
0.0000 |
| C3 |
0.0000 |
1.2891 |
-0.6189 |
|
-0.6189 |
0.0005 |
1.2891 |
| C4 |
0.0000 |
-1.2891 |
-0.6189 |
|
-0.6189 |
0.0005 |
-1.2891 |
| H5 |
-0.0017 |
2.1525 |
0.0611 |
|
0.0611 |
-0.0018 |
2.1525 |
| H6 |
0.0017 |
-2.1525 |
0.0611 |
|
0.0611 |
0.0017 |
-2.1525 |
| H7 |
0.8888 |
1.3292 |
-1.2715 |
|
-1.2709 |
0.8898 |
1.3292 |
| H8 |
-0.8867 |
1.3277 |
-1.2745 |
|
-1.2751 |
-0.8858 |
1.3277 |
| H9 |
-0.8888 |
-1.3292 |
-1.2715 |
|
-1.2722 |
-0.8879 |
-1.3292 |
| H10 |
0.8867 |
-1.3277 |
-1.2745 |
|
-1.2738 |
0.8876 |
-1.3277 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2229 |
1.5201 |
1.5201 |
2.1561 |
2.1561 |
2.1640 |
2.1642 |
2.1640 |
2.1642 |
| O2 |
1.2229 |
| 2.4034 |
2.4034 |
2.5400 |
2.5400 |
3.1217 |
3.1230 |
3.1217 |
3.1230 |
| C3 |
1.5201 |
2.4034 |
| 2.5782 |
1.0990 |
3.5081 |
1.1034 |
1.1034 |
2.8410 |
2.8397 |
| C4 |
1.5201 |
2.4034 |
2.5782 |
| 3.5081 |
1.0990 |
2.8410 |
2.8397 |
1.1034 |
1.1034 |
| H5 |
2.1561 |
2.5400 |
1.0990 |
3.5081 |
| 4.3049 |
1.8018 |
1.8020 |
3.8321 |
3.8321 |
| H6 |
2.1561 |
2.5400 |
3.5081 |
1.0990 |
4.3049 |
| 3.8321 |
3.8321 |
1.8018 |
1.8020 |
| H7 |
2.1640 |
3.1217 |
1.1034 |
2.8410 |
1.8018 |
3.8321 |
| 1.7755 |
3.1980 |
2.6569 |
| H8 |
2.1642 |
3.1230 |
1.1034 |
2.8397 |
1.8020 |
3.8321 |
1.7755 |
| 2.6569 |
3.1932 |
| H9 |
2.1640 |
3.1217 |
2.8410 |
1.1034 |
3.8321 |
1.8018 |
3.1980 |
2.6569 |
| 1.7755 |
| H10 |
2.1642 |
3.1230 |
2.8397 |
1.1034 |
3.8321 |
1.8020 |
2.6569 |
3.1932 |
1.7755 |
|
Maximum atom distance is 4.3049Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
122.000 |
|
O2 |
C1 |
C4 |
122.000 |
|
C3 |
C1 |
C4 |
115.999 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.778 |
|
C1 |
C3 |
H7 |
110.136 |
|
C1 |
C3 |
H8 |
110.154 |
|
C1 |
C4 |
H6 |
109.778 |
|
C1 |
C4 |
H9 |
110.136 |
|
C1 |
C4 |
H10 |
110.154 |
|
H5 |
C3 |
H7 |
109.794 |
|
H5 |
C3 |
H8 |
109.806 |
|
H6 |
C4 |
H9 |
109.794 |
|
H6 |
C4 |
H10 |
109.806 |
|
H7 |
C3 |
H8 |
107.135 |
|
H9 |
C4 |
H10 |
107.135 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.