|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H6 (Dewar Benzene)
1A1 C2V
1910171554
InChI=1S/C6H6/c1-2-6-4-3-5(1)6/h1-6H INChIKey=CTLSARLLLBZBRV-UHFFFAOYSA-N
B3LYPultrafine/cc-pVDZ
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.7884 |
0.5235 |
|
0.0000 |
0.7884 |
0.5235 |
| C2 |
0.0000 |
-0.7884 |
0.5235 |
|
0.0000 |
-0.7884 |
0.5235 |
| H3 |
0.0000 |
1.3581 |
1.4643 |
|
0.0000 |
1.3581 |
1.4643 |
| H4 |
0.0000 |
-1.3581 |
1.4643 |
|
0.0000 |
-1.3581 |
1.4643 |
| C5 |
-1.3089 |
0.6720 |
-0.2652 |
|
-1.3089 |
0.6720 |
-0.2652 |
| C6 |
1.3089 |
0.6720 |
-0.2652 |
|
1.3089 |
0.6720 |
-0.2652 |
| C7 |
1.3089 |
-0.6720 |
-0.2652 |
|
1.3089 |
-0.6720 |
-0.2652 |
| C8 |
-1.3089 |
-0.6720 |
-0.2652 |
|
-1.3089 |
-0.6720 |
-0.2652 |
| H9 |
-1.9629 |
1.4255 |
-0.7113 |
|
-1.9629 |
1.4255 |
-0.7113 |
| H10 |
1.9629 |
1.4255 |
-0.7113 |
|
1.9629 |
1.4255 |
-0.7113 |
| H11 |
1.9629 |
-1.4255 |
-0.7113 |
|
1.9629 |
-1.4255 |
-0.7113 |
| H12 |
-1.9629 |
-1.4255 |
-0.7113 |
|
-1.9629 |
-1.4255 |
-0.7113 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
C5 |
C6 |
C7 |
C8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.5768 |
1.0998 |
2.3436 |
1.5326 |
1.5326 |
2.1138 |
2.1138 |
2.4049 |
2.4049 |
3.2061 |
3.2061 |
| C2 |
1.5768 |
| 2.3436 |
1.0998 |
2.1138 |
2.1138 |
1.5326 |
1.5326 |
3.2061 |
3.2061 |
2.4049 |
2.4049 |
| H3 |
1.0998 |
2.3436 |
| 2.7162 |
2.2749 |
2.2749 |
2.9708 |
2.9708 |
2.9310 |
2.9310 |
4.0416 |
4.0416 |
| H4 |
2.3436 |
1.0998 |
2.7162 |
| 2.9708 |
2.9708 |
2.2749 |
2.2749 |
4.0416 |
4.0416 |
2.9310 |
2.9310 |
| C5 |
1.5326 |
2.1138 |
2.2749 |
2.9708 |
| 2.6179 |
2.9427 |
1.3440 |
1.0929 |
3.3870 |
3.9119 |
2.2419 |
| C6 |
1.5326 |
2.1138 |
2.2749 |
2.9708 |
2.6179 |
|
1.3440 |
2.9427 |
3.3870 |
1.0929 |
2.2419 |
3.9119 |
| C7 |
2.1138 |
1.5326 |
2.9708 |
2.2749 |
2.9427 |
1.3440 |
| 2.6179 |
3.9119 |
2.2419 |
1.0929 |
3.3870 |
| C8 |
2.1138 |
1.5326 |
2.9708 |
2.2749 |
1.3440 |
2.9427 |
2.6179 |
| 2.2419 |
3.9119 |
3.3870 |
1.0929 |
| H9 |
2.4049 |
3.2061 |
2.9310 |
4.0416 |
1.0929 |
3.3870 |
3.9119 |
2.2419 |
| 3.9259 |
4.8518 |
2.8509 |
| H10 |
2.4049 |
3.2061 |
2.9310 |
4.0416 |
3.3870 |
1.0929 |
2.2419 |
3.9119 |
3.9259 |
| 2.8509 |
4.8518 |
| H11 |
3.2061 |
2.4049 |
4.0416 |
2.9310 |
3.9119 |
2.2419 |
1.0929 |
3.3870 |
4.8518 |
2.8509 |
| 3.9259 |
| H12 |
3.2061 |
2.4049 |
4.0416 |
2.9310 |
2.2419 |
3.9119 |
3.3870 |
1.0929 |
2.8509 |
4.8518 |
3.9259 |
|
Maximum atom distance is 4.8518Å
between atoms H9 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
121.198 |
|
C2 |
C1 |
C3 |
121.198 |
|
C2 |
C1 |
C5 |
85.644 |
|
C2 |
C1 |
C6 |
85.644 |
|
C3 |
C1 |
C5 |
118.655 |
|
C3 |
C1 |
C6 |
118.655 |
|
C5 |
C1 |
C6 |
117.309 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H7 |
85.644 |
|
C1 |
C2 |
H8 |
85.644 |
|
C1 |
C5 |
H8 |
94.356 |
|
C1 |
C5 |
H9 |
131.971 |
|
C1 |
C6 |
H7 |
94.356 |
|
C1 |
C6 |
H10 |
131.971 |
|
C2 |
H7 |
C6 |
94.356 |
|
C2 |
H7 |
H11 |
131.971 |
|
C2 |
H8 |
C5 |
94.356 |
|
C2 |
H8 |
H12 |
131.971 |
|
C4 |
C2 |
H7 |
118.655 |
|
C4 |
C2 |
H8 |
118.655 |
|
C5 |
H8 |
H12 |
133.585 |
|
C6 |
H7 |
H11 |
133.585 |
|
H7 |
C6 |
H10 |
133.585 |
|
H8 |
C5 |
H9 |
133.585 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.