|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF2CH2F (Ethane, 1,1,2-trifluoro)
1A C1
1910171554
InChI=1S/C2H3F3/c3-1-2(4)5/h2H,1H2 INChIKey=WGZYQOSEVSXDNI-UHFFFAOYSA-N
BLYP/cc-pVTZ
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.7802 |
-0.5887 |
-0.2970 |
|
-0.7590 |
-0.6017 |
-0.3245 |
| C2 |
0.4677 |
0.0201 |
0.3309 |
|
0.4618 |
0.0241 |
0.3388 |
| F3 |
-1.9108 |
0.1053 |
0.1584 |
|
-1.9152 |
0.0493 |
0.1302 |
| F4 |
1.5511 |
-0.7794 |
-0.0027 |
|
1.5718 |
-0.7367 |
0.0024 |
| F5 |
0.6987 |
1.2801 |
-0.1825 |
|
0.6660 |
1.3028 |
-0.1384 |
| H6 |
-0.7226 |
-0.5047 |
-1.3893 |
|
-0.6869 |
-0.4877 |
-1.4133 |
| H7 |
-0.8668 |
-1.6408 |
0.0022 |
|
-0.8213 |
-1.6632 |
-0.0538 |
| H8 |
0.4135 |
0.1034 |
1.4243 |
|
0.3885 |
0.0775 |
1.4330 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
F3 |
F4 |
F5 |
H6 |
H7 |
H8 |
| C1 |
|
1.5239 |
1.4026 |
2.3575 |
2.3859 |
1.0971 |
1.0972 |
2.2061 |
| C2 |
1.5239 |
| 2.3863 |
1.3871 |
1.3800 |
2.1568 |
2.1558 |
1.0979 |
| F3 |
1.4026 |
2.3863 |
| 3.5768 |
2.8820 |
2.0444 |
2.0404 |
2.6467 |
| F4 |
2.3575 |
1.3871 |
3.5768 |
| 2.2361 |
2.6773 |
2.5667 |
2.0272 |
| F5 |
2.3859 |
1.3800 |
2.8820 |
2.2361 |
| 2.5810 |
3.3191 |
2.0119 |
| H6 |
1.0971 |
2.1568 |
2.0444 |
2.6773 |
2.5810 |
| 1.8022 |
3.0947 |
| H7 |
1.0972 |
2.1558 |
2.0404 |
2.5667 |
3.3191 |
1.8022 |
| 2.5892 |
| H8 |
2.2061 |
1.0979 |
2.6467 |
2.0272 |
2.0119 |
3.0947 |
2.5892 |
|
Maximum atom distance is 3.5768Å
between atoms F3 and F4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F4 |
108.075 |
|
C1 |
C2 |
F5 |
110.394 |
|
C2 |
C1 |
F3 |
109.190 |
|
F4 |
C2 |
F5 |
107.819 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H8 |
113.593 |
|
C2 |
C1 |
H6 |
109.676 |
|
C2 |
C1 |
H7 |
109.592 |
|
F3 |
C1 |
H6 |
109.128 |
|
F3 |
C1 |
H7 |
108.803 |
|
F4 |
C2 |
H8 |
108.774 |
|
F5 |
C2 |
H8 |
108.028 |
|
H6 |
C1 |
H7 |
110.427 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.