|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH(CH3)ONO (Isopropyl nitrite)
1A C1
1910171554
InChI=1S/C3H7NO2/c1-3(2)6-4-5/h3H,1-2H3 INChIKey=SKRDXYBATCVEMS-UHFFFAOYSA-N
B1B95/cc-pVTZ
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| H1 |
0.5375 |
-0.0001 |
-1.3548 |
|
0.5397 |
-0.0000 |
-1.3539 |
| C2 |
0.8004 |
-0.0000 |
-0.2967 |
|
0.8009 |
-0.0000 |
-0.2953 |
| H3 |
2.4989 |
1.2954 |
-0.4849 |
|
2.4997 |
1.2954 |
-0.4806 |
| H4 |
1.7663 |
1.2949 |
1.1202 |
|
1.7644 |
1.2948 |
1.1232 |
| H5 |
0.9758 |
2.1439 |
-0.2103 |
|
0.9761 |
2.1439 |
-0.2086 |
| C6 |
1.5539 |
1.2619 |
0.0534 |
|
1.5538 |
1.2619 |
0.0561 |
| H7 |
2.4987 |
-1.2955 |
-0.4852 |
|
2.4995 |
-1.2956 |
-0.4810 |
| H8 |
0.9757 |
-2.1439 |
-0.2099 |
|
0.9760 |
-2.1439 |
-0.2084 |
| H9 |
1.7667 |
-1.2947 |
1.1202 |
|
1.7648 |
-1.2948 |
1.1231 |
| C10 |
1.5539 |
-1.2619 |
0.0535 |
|
1.5538 |
-1.2619 |
0.0560 |
| O11 |
-0.4391 |
0.0000 |
0.4325 |
|
-0.4399 |
0.0000 |
0.4318 |
| O12 |
-2.5346 |
-0.0000 |
0.1512 |
|
-2.5348 |
0.0000 |
0.1469 |
| N13 |
-1.5256 |
-0.0000 |
-0.4323 |
|
-1.5249 |
0.0000 |
-0.4349 |
Atom - Atom Distances (Å)
| |
H1 |
C2 |
H3 |
H4 |
H5 |
C6 |
H7 |
H8 |
H9 |
C10 |
O11 |
O12 |
N13 |
| H1 |
|
1.0903 |
2.5064 |
3.0516 |
2.4695 |
2.1468 |
2.5062 |
2.4695 |
3.0516 |
2.1468 |
2.0367 |
3.4213 |
2.2599 |
| C2 |
1.0903 |
| 2.1444 |
2.1488 |
2.1528 |
1.5109 |
2.1443 |
2.1528 |
2.1488 |
1.5109 |
1.4381 |
3.3649 |
2.3299 |
| H3 |
2.5064 |
2.1444 |
| 1.7643 |
1.7649 |
1.0880 |
2.5910 |
3.7716 |
3.1338 |
2.7790 |
3.3394 |
5.2362 |
4.2281 |
| H4 |
3.0516 |
2.1488 |
1.7643 |
| 1.7652 |
1.0882 |
3.1343 |
3.7708 |
2.5896 |
2.7785 |
2.6483 |
4.5949 |
3.8631 |
| H5 |
2.4695 |
2.1528 |
1.7649 |
1.7652 |
|
1.0870 |
3.7715 |
4.2877 |
3.7709 |
3.4646 |
2.6479 |
4.1291 |
3.3019 |
| C6 |
2.1468 |
1.5109 |
1.0880 |
1.0882 |
1.0870 |
| 2.7791 |
3.4645 |
2.7784 |
2.5238 |
2.3892 |
4.2799 |
3.3633 |
| H7 |
2.5062 |
2.1443 |
2.5910 |
3.1343 |
3.7715 |
2.7791 |
| 1.7649 |
1.7643 |
1.0880 |
3.3394 |
5.2361 |
4.2280 |
| H8 |
2.4695 |
2.1528 |
3.7716 |
3.7708 |
4.2877 |
3.4645 |
1.7649 |
| 1.7652 |
1.0870 |
2.6478 |
4.1290 |
3.3018 |
| H9 |
3.0516 |
2.1488 |
3.1338 |
2.5896 |
3.7709 |
2.7784 |
1.7643 |
1.7652 |
|
1.0882 |
2.6486 |
4.5952 |
3.8634 |
| C10 |
2.1468 |
1.5109 |
2.7790 |
2.7785 |
3.4646 |
2.5238 |
1.0880 |
1.0870 |
1.0882 |
| 2.3893 |
4.2799 |
3.3633 |
| O11 |
2.0367 |
1.4381 |
3.3394 |
2.6483 |
2.6479 |
2.3892 |
3.3394 |
2.6478 |
2.6486 |
2.3893 |
| 2.1142 |
1.3887 |
| O12 |
3.4213 |
3.3649 |
5.2362 |
4.5949 |
4.1291 |
4.2799 |
5.2361 |
4.1290 |
4.5952 |
4.2799 |
2.1142 |
|
1.1656 |
| N13 |
2.2599 |
2.3299 |
4.2281 |
3.8631 |
3.3019 |
3.3633 |
4.2280 |
3.3018 |
3.8634 |
3.3633 |
1.3887 |
1.1656 |
|
Maximum atom distance is 5.2362Å
between atoms H3 and O12.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
O11 |
N13 |
111.009 |
|
C6 |
C2 |
C10 |
113.274 |
|
C6 |
C2 |
O11 |
108.200 |
|
C10 |
C2 |
O11 |
108.203 |
|
O11 |
N13 |
O12 |
111.436 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H1 |
C2 |
C6 |
110.195 |
|
H1 |
C2 |
C10 |
110.190 |
|
H1 |
C2 |
O11 |
106.513 |
|
C2 |
C6 |
H3 |
110.135 |
|
C2 |
C6 |
H4 |
110.475 |
|
C2 |
C6 |
H5 |
110.865 |
|
C2 |
C10 |
H7 |
110.130 |
|
C2 |
C10 |
H8 |
110.865 |
|
C2 |
C10 |
H9 |
110.478 |
|
H3 |
C6 |
H4 |
108.335 |
|
H3 |
C6 |
H5 |
108.474 |
|
H4 |
C6 |
H5 |
108.486 |
|
H7 |
C10 |
H8 |
108.474 |
|
H7 |
C10 |
H9 |
108.336 |
|
H8 |
C10 |
H9 |
108.486 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.