|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for (difluorodichloroethylene)
1A1 C2V
1910171554
InChI=1S/C2Cl2F2/c3-1(4)2(5)6 INChIKey=QDGONURINHVBEW-UHFFFAOYSA-N
CCSD(T)/cc-pVTZ
Point group is C2v
Atom |
Internal |
|
Principal |
x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
C1 |
0.0000 |
0.0000 |
1.0972 |
|
1.0972 |
0.0000 |
0.0000 |
C2 |
0.0000 |
0.0000 |
-0.2378 |
|
-0.2378 |
0.0000 |
0.0000 |
F3 |
0.0000 |
1.0864 |
1.8326 |
|
1.8326 |
1.0864 |
0.0000 |
F4 |
0.0000 |
-1.0864 |
1.8326 |
|
1.8326 |
-1.0864 |
0.0000 |
Cl5 |
0.0000 |
1.4771 |
-1.1219 |
|
-1.1219 |
1.4771 |
0.0000 |
Cl6 |
0.0000 |
-1.4771 |
-1.1219 |
|
-1.1219 |
-1.4771 |
0.0000 |
Atom - Atom Distances (Å)
|
C1 |
C2 |
F3 |
F4 |
Cl5 |
Cl6 |
C1 |
|
1.3350 |
1.3119 |
1.3119 |
2.6657 |
2.6657 |
C2 |
1.3350 |
| 2.3381 |
2.3381 |
1.7215 |
1.7215 |
F3 |
1.3119 |
2.3381 |
| 2.1727 |
2.9802 |
3.9116 |
F4 |
1.3119 |
2.3381 |
2.1727 |
| 3.9116 |
2.9802 |
Cl5 |
2.6657 |
1.7215 |
2.9802 |
3.9116 |
| 2.9542 |
Cl6 |
2.6657 |
1.7215 |
3.9116 |
2.9802 |
2.9542 |
|
Maximum atom distance is 3.9116Å
between atoms F3 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
C1 |
C2 |
Cl5 |
120.902 |
|
C1 |
C2 |
Cl6 |
120.902 |
C2 |
C1 |
F3 |
124.097 |
|
C2 |
C1 |
F4 |
124.097 |
F3 |
C1 |
F4 |
111.807 |
|
Cl5 |
C2 |
Cl6 |
118.197 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.