|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH2COOH (Propanoic Acid)
1A' CS
1910171554
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) INChIKey=XBDQKXXYIPTUBI-UHFFFAOYSA-N
B3LYPultrafine/cc-pVTZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.5724 |
0.0000 |
|
0.5626 |
-0.1054 |
0.0000 |
| C2 |
-0.5927 |
-0.8147 |
0.0000 |
|
-0.9100 |
-0.4325 |
0.0000 |
| C3 |
0.4567 |
-1.9180 |
0.0000 |
|
-1.8011 |
0.8022 |
0.0000 |
| O4 |
-0.9655 |
1.5247 |
0.0000 |
|
1.3208 |
-1.2298 |
0.0000 |
| O5 |
1.1728 |
0.8442 |
0.0000 |
|
1.0457 |
0.9972 |
0.0000 |
| H6 |
-1.2514 |
-0.8874 |
0.8689 |
|
-1.1026 |
-1.0665 |
0.8689 |
| H7 |
-1.2514 |
-0.8874 |
-0.8689 |
|
-1.1026 |
-1.0665 |
-0.8689 |
| H8 |
-0.0227 |
-2.8966 |
0.0000 |
|
-2.8512 |
0.5112 |
0.0000 |
| H9 |
1.0973 |
-1.8489 |
-0.8779 |
|
-1.6151 |
1.4190 |
-0.8779 |
| H10 |
1.0973 |
-1.8489 |
0.8779 |
|
-1.6151 |
1.4190 |
0.8779 |
| H11 |
-0.5115 |
2.3802 |
0.0000 |
|
2.2452 |
-0.9411 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
O5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5084 |
2.5319 |
1.3562 |
1.2039 |
2.1099 |
2.1099 |
3.4690 |
2.7995 |
2.7995 |
1.8788 |
| C2 |
1.5084 |
|
1.5226 |
2.3690 |
2.4226 |
1.0928 |
1.0928 |
2.1585 |
2.1670 |
2.1670 |
3.1959 |
| C3 |
2.5319 |
1.5226 |
| 3.7249 |
2.8535 |
2.1760 |
2.1760 |
1.0897 |
1.0889 |
1.0889 |
4.4059 |
| O4 |
1.3562 |
2.3690 |
3.7249 |
| 2.2440 |
2.5797 |
2.5797 |
4.5207 |
4.0505 |
4.0505 |
0.9685 |
| O5 |
1.2039 |
2.4226 |
2.8535 |
2.2440 |
| 3.1032 |
3.1032 |
3.9272 |
2.8335 |
2.8335 |
2.2795 |
| H6 |
2.1099 |
1.0928 |
2.1760 |
2.5797 |
3.1032 |
| 1.7379 |
2.5103 |
3.0809 |
2.5378 |
3.4611 |
| H7 |
2.1099 |
1.0928 |
2.1760 |
2.5797 |
3.1032 |
1.7379 |
| 2.5103 |
2.5378 |
3.0809 |
3.4611 |
| H8 |
3.4690 |
2.1585 |
1.0897 |
4.5207 |
3.9272 |
2.5103 |
2.5103 |
| 1.7671 |
1.7671 |
5.2994 |
| H9 |
2.7995 |
2.1670 |
1.0889 |
4.0505 |
2.8335 |
3.0809 |
2.5378 |
1.7671 |
| 1.7558 |
4.6091 |
| H10 |
2.7995 |
2.1670 |
1.0889 |
4.0505 |
2.8335 |
2.5378 |
3.0809 |
1.7671 |
1.7558 |
| 4.6091 |
| H11 |
1.8788 |
3.1959 |
4.4059 |
0.9685 |
2.2795 |
3.4611 |
3.4611 |
5.2994 |
4.6091 |
4.6091 |
|
Maximum atom distance is 5.2994Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
113.297 |
|
C2 |
C1 |
O4 |
111.470 |
|
C2 |
C1 |
O5 |
126.186 |
|
O4 |
C1 |
O5 |
122.343 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
107.333 |
|
C1 |
C2 |
H7 |
107.333 |
|
C1 |
O4 |
H11 |
106.652 |
|
C2 |
C3 |
H8 |
110.334 |
|
C2 |
C3 |
H9 |
111.063 |
|
C2 |
C3 |
H10 |
111.063 |
|
C3 |
C2 |
H6 |
111.548 |
|
C3 |
C2 |
H7 |
111.548 |
|
H6 |
C2 |
H7 |
105.340 |
|
H8 |
C3 |
H9 |
108.409 |
|
H8 |
C3 |
H10 |
108.409 |
|
H9 |
C3 |
H10 |
107.453 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.