|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H6 (Trimethylenecycopropane)
1A' D3H
1910171554
InChI=1S/C6H6/c1-4-5(2)6(4)3/h1-3H2 INChIKey=UPWZWQGQRNPKTE-UHFFFAOYSA-N
BLYP/cc-pVTZ
Point group is D3h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.8347 |
0.0000 |
|
-0.5081 |
0.6623 |
0.0000 |
| C2 |
0.7229 |
-0.4174 |
0.0000 |
|
0.8276 |
0.1089 |
0.0000 |
| C3 |
-0.7229 |
-0.4174 |
0.0000 |
|
-0.3195 |
-0.7712 |
0.0000 |
| C4 |
0.0000 |
2.1751 |
0.0000 |
|
-1.3239 |
1.7257 |
0.0000 |
| C5 |
1.8837 |
-1.0875 |
0.0000 |
|
2.1565 |
0.2837 |
0.0000 |
| C6 |
-1.8837 |
-1.0875 |
0.0000 |
|
-0.8326 |
-2.0094 |
0.0000 |
| H7 |
-0.9299 |
2.7399 |
0.0000 |
|
-2.4055 |
1.6078 |
0.0000 |
| H8 |
0.9299 |
2.7399 |
0.0000 |
|
-0.9299 |
2.7399 |
0.0000 |
| H9 |
2.8378 |
-0.5646 |
0.0000 |
|
2.5952 |
1.2793 |
0.0000 |
| H10 |
1.9079 |
-2.1753 |
0.0000 |
|
2.8378 |
-0.5646 |
0.0000 |
| H11 |
-1.9079 |
-2.1753 |
0.0000 |
|
-0.1897 |
-2.8872 |
0.0000 |
| H12 |
-2.8378 |
-0.5646 |
0.0000 |
|
-1.9079 |
-2.1753 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.4458 |
1.4458 |
1.3403 |
2.6914 |
2.6914 |
2.1200 |
2.1200 |
3.1641 |
3.5637 |
3.5637 |
3.1641 |
| C2 |
1.4458 |
|
1.4458 |
2.6914 |
1.3403 |
2.6914 |
3.5637 |
3.1641 |
2.1200 |
2.1200 |
3.1641 |
3.5637 |
| C3 |
1.4458 |
1.4458 |
| 2.6914 |
2.6914 |
1.3403 |
3.1641 |
3.5637 |
3.5637 |
3.1641 |
2.1200 |
2.1200 |
| C4 |
1.3403 |
2.6914 |
2.6914 |
| 3.7674 |
3.7674 |
1.0880 |
1.0880 |
3.9445 |
4.7503 |
4.7503 |
3.9445 |
| C5 |
2.6914 |
1.3403 |
2.6914 |
3.7674 |
| 3.7674 |
4.7503 |
3.9445 |
1.0880 |
1.0880 |
3.9445 |
4.7503 |
| C6 |
2.6914 |
2.6914 |
1.3403 |
3.7674 |
3.7674 |
| 3.9445 |
4.7503 |
4.7503 |
3.9445 |
1.0880 |
1.0880 |
| H7 |
2.1200 |
3.5637 |
3.1641 |
1.0880 |
4.7503 |
3.9445 |
| 1.8598 |
5.0115 |
5.6756 |
5.0115 |
3.8157 |
| H8 |
2.1200 |
3.1641 |
3.5637 |
1.0880 |
3.9445 |
4.7503 |
1.8598 |
| 3.8157 |
5.0115 |
5.6756 |
5.0115 |
| H9 |
3.1641 |
2.1200 |
3.5637 |
3.9445 |
1.0880 |
4.7503 |
5.0115 |
3.8157 |
| 1.8598 |
5.0115 |
5.6756 |
| H10 |
3.5637 |
2.1200 |
3.1641 |
4.7503 |
1.0880 |
3.9445 |
5.6756 |
5.0115 |
1.8598 |
| 3.8157 |
5.0115 |
| H11 |
3.5637 |
3.1641 |
2.1200 |
4.7503 |
3.9445 |
1.0880 |
5.0115 |
5.6756 |
5.0115 |
3.8157 |
| 1.8598 |
| H12 |
3.1641 |
3.5637 |
2.1200 |
3.9445 |
4.7503 |
1.0880 |
3.8157 |
5.0115 |
5.6756 |
5.0115 |
1.8598 |
|
Maximum atom distance is 5.6756Å
between atoms H7 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
60.000 |
|
C1 |
C2 |
C5 |
150.000 |
|
C1 |
C3 |
C2 |
60.000 |
|
C1 |
C3 |
C6 |
150.000 |
|
C2 |
C1 |
C3 |
60.000 |
|
C2 |
C1 |
C4 |
150.000 |
|
C2 |
C3 |
C6 |
150.000 |
|
C3 |
C1 |
C4 |
150.000 |
|
C3 |
C2 |
C5 |
150.000 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
H7 |
121.274 |
|
C1 |
C4 |
H8 |
121.274 |
|
C2 |
C5 |
H9 |
121.274 |
|
C2 |
C5 |
H10 |
121.274 |
|
C3 |
C6 |
H11 |
121.274 |
|
C3 |
C6 |
H12 |
121.274 |
|
H7 |
C4 |
H8 |
117.453 |
|
H9 |
C5 |
H10 |
117.453 |
|
H11 |
C6 |
H12 |
117.453 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.