|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHCl2CHO (dichloroacetaldehyde)
1A C1
1910171554
InChI=1S/C2H2Cl2O/c3-2(4)1-5/h1-2H INChIKey=NWQWQKUXRJYXFH-UHFFFAOYSA-N
CCSD(T)=FULL/cc-pVTZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.3360 |
0.2089 |
0.0000 |
|
-0.0546 |
0.3315 |
0.2089 |
| C2 |
-0.9276 |
1.0443 |
0.0000 |
|
0.1506 |
-0.9153 |
1.0443 |
| H3 |
1.2165 |
0.8324 |
0.0000 |
|
-0.1975 |
1.2004 |
0.8324 |
| Cl4 |
0.3360 |
-0.7877 |
1.4687 |
|
1.3947 |
0.5700 |
-0.7877 |
| Cl5 |
0.3360 |
-0.7877 |
-1.4687 |
|
-1.5038 |
0.0931 |
-0.7877 |
| O6 |
-0.9046 |
2.2466 |
0.0000 |
|
0.1469 |
-0.8926 |
2.2466 |
| H7 |
-1.8544 |
0.4575 |
0.0000 |
|
0.3011 |
-1.8298 |
0.4575 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
Cl4 |
Cl5 |
O6 |
H7 |
| C1 |
|
1.5148 |
1.0789 |
1.7749 |
1.7749 |
2.3856 |
2.2044 |
| C2 |
1.5148 |
| 2.1546 |
2.6665 |
2.6665 |
1.2025 |
1.0970 |
| H3 |
1.0789 |
2.1546 |
| 2.3573 |
2.3573 |
2.5493 |
3.0937 |
| Cl4 |
1.7749 |
2.6665 |
2.3573 |
| 2.9375 |
3.5921 |
2.9164 |
| Cl5 |
1.7749 |
2.6665 |
2.3573 |
2.9375 |
| 3.5921 |
2.9164 |
| O6 |
2.3856 |
1.2025 |
2.5493 |
3.5921 |
3.5921 |
| 2.0256 |
| H7 |
2.2044 |
1.0970 |
3.0937 |
2.9164 |
2.9164 |
2.0256 |
|
Maximum atom distance is 3.5921Å
between atoms Cl4 and O6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O6 |
122.376 |
|
C2 |
C1 |
Cl4 |
108.040 |
|
C2 |
C1 |
Cl5 |
108.040 |
|
Cl4 |
C1 |
Cl5 |
111.685 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H7 |
114.184 |
|
C2 |
C1 |
H3 |
111.225 |
|
H3 |
C1 |
Cl4 |
108.933 |
|
H3 |
C1 |
Cl5 |
108.933 |
|
O6 |
C2 |
H7 |
123.440 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.