|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for ClCOClCO (Oxalyl chloride)
1AG C2H
1910171554
InChI=1S/C2Cl2O2/c3-1(5)2(4)6 INChIKey=CTSLXHKWHWQRSH-UHFFFAOYSA-N
CCSD=FULL/cc-pVTZ
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1667 |
0.7517 |
0.0000 |
|
0.7288 |
0.2481 |
0.0000 |
| C2 |
0.1667 |
-0.7517 |
0.0000 |
|
-0.7288 |
-0.2481 |
0.0000 |
| O3 |
-1.2638 |
1.1827 |
0.0000 |
|
1.6672 |
-0.4652 |
0.0000 |
| O4 |
1.2638 |
-1.1827 |
0.0000 |
|
-1.6672 |
0.4652 |
0.0000 |
| Cl5 |
1.2638 |
1.7448 |
0.0000 |
|
0.8341 |
1.9864 |
0.0000 |
| Cl6 |
-1.2638 |
-1.7448 |
0.0000 |
|
-0.8341 |
-1.9864 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
O4 |
Cl5 |
Cl6 |
| C1 |
|
1.5398 |
1.1787 |
2.4059 |
1.7415 |
2.7269 |
| C2 |
1.5398 |
| 2.4059 |
1.1787 |
2.7269 |
1.7415 |
| O3 |
1.1787 |
2.4059 |
| 3.4618 |
2.5893 |
2.9275 |
| O4 |
2.4059 |
1.1787 |
3.4618 |
| 2.9275 |
2.5893 |
| Cl5 |
1.7415 |
2.7269 |
2.5893 |
2.9275 |
| 4.3088 |
| Cl6 |
2.7269 |
1.7415 |
2.9275 |
2.5893 |
4.3088 |
|
Maximum atom distance is 4.3088Å
between atoms Cl5 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O4 |
123.956 |
|
C1 |
C2 |
Cl6 |
112.266 |
|
C2 |
C1 |
O3 |
123.956 |
|
C2 |
C1 |
Cl5 |
112.266 |
|
O3 |
C1 |
Cl5 |
123.778 |
|
O4 |
C2 |
Cl6 |
123.778 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.