|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH2C(CH3)CH3 (1-Propene, 2-methyl-)
1A1 C2V
1910171554
InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3 INChIKey=VQTUBCCKSQIDNK-UHFFFAOYSA-N
B2PLYP/cc-pVTZ
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1118 |
|
0.1118 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
0.0000 |
1.4465 |
|
1.4465 |
0.0000 |
0.0000 |
| H3 |
0.0000 |
0.9213 |
2.0124 |
|
2.0124 |
0.0000 |
0.9213 |
| H4 |
0.0000 |
-0.9213 |
2.0124 |
|
2.0124 |
0.0000 |
-0.9213 |
| C5 |
0.0000 |
1.2859 |
-0.6729 |
|
-0.6729 |
0.0000 |
1.2859 |
| C6 |
0.0000 |
-1.2859 |
-0.6729 |
|
-0.6729 |
0.0000 |
-1.2859 |
| H7 |
0.0000 |
2.1463 |
-0.0094 |
|
-0.0094 |
0.0000 |
2.1463 |
| H8 |
0.8765 |
1.3441 |
-1.3201 |
|
-1.3201 |
0.8765 |
1.3441 |
| H9 |
-0.8765 |
1.3441 |
-1.3201 |
|
-1.3201 |
-0.8765 |
1.3441 |
| H10 |
0.0000 |
-2.1463 |
-0.0094 |
|
-0.0094 |
0.0000 |
-2.1463 |
| H11 |
-0.8765 |
-1.3441 |
-1.3201 |
|
-1.3201 |
-0.8765 |
-1.3441 |
| H12 |
0.8765 |
-1.3441 |
-1.3201 |
|
-1.3201 |
0.8765 |
-1.3441 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.3347 |
2.1121 |
2.1121 |
1.5064 |
1.5064 |
2.1497 |
2.1506 |
2.1506 |
2.1497 |
2.1506 |
2.1506 |
| C2 |
1.3347 |
|
1.0812 |
1.0812 |
2.4790 |
2.4790 |
2.5935 |
3.1983 |
3.1983 |
2.5935 |
3.1983 |
3.1983 |
| H3 |
2.1121 |
1.0812 |
| 1.8425 |
2.7100 |
3.4760 |
2.3639 |
3.4717 |
3.4717 |
3.6739 |
4.1238 |
4.1238 |
| H4 |
2.1121 |
1.0812 |
1.8425 |
| 3.4760 |
2.7100 |
3.6739 |
4.1238 |
4.1238 |
2.3639 |
3.4717 |
3.4717 |
| C5 |
1.5064 |
2.4790 |
2.7100 |
3.4760 |
| 2.5717 |
1.0865 |
1.0911 |
1.0911 |
3.4957 |
2.8467 |
2.8467 |
| C6 |
1.5064 |
2.4790 |
3.4760 |
2.7100 |
2.5717 |
| 3.4957 |
2.8467 |
2.8467 |
1.0865 |
1.0911 |
1.0911 |
| H7 |
2.1497 |
2.5935 |
2.3639 |
3.6739 |
1.0865 |
3.4957 |
| 1.7691 |
1.7691 |
4.2925 |
3.8300 |
3.8300 |
| H8 |
2.1506 |
3.1983 |
3.4717 |
4.1238 |
1.0911 |
2.8467 |
1.7691 |
| 1.7529 |
3.8300 |
3.2092 |
2.6882 |
| H9 |
2.1506 |
3.1983 |
3.4717 |
4.1238 |
1.0911 |
2.8467 |
1.7691 |
1.7529 |
| 3.8300 |
2.6882 |
3.2092 |
| H10 |
2.1497 |
2.5935 |
3.6739 |
2.3639 |
3.4957 |
1.0865 |
4.2925 |
3.8300 |
3.8300 |
| 1.7691 |
1.7691 |
| H11 |
2.1506 |
3.1983 |
4.1238 |
3.4717 |
2.8467 |
1.0911 |
3.8300 |
3.2092 |
2.6882 |
1.7691 |
| 1.7529 |
| H12 |
2.1506 |
3.1983 |
4.1238 |
3.4717 |
2.8467 |
1.0911 |
3.8300 |
2.6882 |
3.2092 |
1.7691 |
1.7529 |
|
Maximum atom distance is 4.2925Å
between atoms H7 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
C5 |
121.395 |
|
C2 |
C1 |
C6 |
121.395 |
|
C5 |
C1 |
C6 |
117.211 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H3 |
121.558 |
|
C1 |
C2 |
H4 |
121.558 |
|
C1 |
C5 |
H7 |
110.965 |
|
C1 |
C5 |
H8 |
110.767 |
|
C1 |
C5 |
H9 |
110.767 |
|
C1 |
C6 |
H10 |
110.965 |
|
C1 |
C6 |
H11 |
110.767 |
|
C1 |
C6 |
H12 |
110.767 |
|
H3 |
C2 |
H4 |
116.883 |
|
H7 |
C5 |
H8 |
108.663 |
|
H7 |
C5 |
H9 |
108.663 |
|
H8 |
C5 |
H9 |
106.893 |
|
H10 |
C6 |
H11 |
108.663 |
|
H10 |
C6 |
H12 |
108.663 |
|
H11 |
C6 |
H12 |
106.893 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.