|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH2CHCONH2 (Acrylamide)
1A CS
1910171554
InChI=1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) INChIKey=HRPVXLWXLXDGHG-UHFFFAOYSA-N
B3LYPultrafine/cc-pVTZ
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.8025 |
-0.6446 |
-0.0110 |
|
-0.7829 |
-0.6683 |
-0.0080 |
| C2 |
-0.4788 |
0.1333 |
-0.0021 |
|
0.4746 |
0.1475 |
-0.0034 |
| N3 |
-1.6048 |
-0.6416 |
-0.0154 |
|
1.6232 |
-0.5934 |
-0.0179 |
| O4 |
-0.5209 |
1.3475 |
-0.0030 |
|
0.4804 |
1.3625 |
-0.0067 |
| C5 |
1.9755 |
-0.0261 |
0.0094 |
|
-1.9738 |
-0.0851 |
0.0140 |
| H6 |
0.7448 |
-1.7271 |
-0.0354 |
|
-0.6930 |
-1.7487 |
-0.0305 |
| H7 |
-2.4960 |
-0.1818 |
0.0591 |
|
2.5004 |
-0.1070 |
0.0537 |
| H8 |
-1.5698 |
-1.6384 |
0.0956 |
|
1.6183 |
-1.5906 |
0.0950 |
| H9 |
2.0177 |
1.0549 |
0.0307 |
|
-2.0483 |
0.9943 |
0.0334 |
| H10 |
2.9089 |
-0.5721 |
0.0043 |
|
-2.8905 |
-0.6588 |
0.0120 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
N3 |
O4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.4990 |
2.4072 |
2.3916 |
1.3262 |
1.0843 |
3.3315 |
2.5743 |
2.0897 |
2.1078 |
| C2 |
1.4990 |
|
1.3669 |
1.2150 |
2.4595 |
2.2270 |
2.0425 |
2.0830 |
2.6615 |
3.4604 |
| N3 |
2.4072 |
1.3669 |
| 2.2653 |
3.6328 |
2.5883 |
1.0056 |
1.0036 |
4.0004 |
4.5143 |
| O4 |
2.3916 |
1.2150 |
2.2653 |
| 2.8493 |
3.3252 |
2.4987 |
3.1664 |
2.5557 |
3.9305 |
| C5 |
1.3262 |
2.4595 |
3.6328 |
2.8493 |
| 2.1000 |
4.4744 |
3.8956 |
1.0821 |
1.0815 |
| H6 |
1.0843 |
2.2270 |
2.5883 |
3.3252 |
2.1000 |
| 3.5916 |
2.3200 |
3.0602 |
2.4533 |
| H7 |
3.3315 |
2.0425 |
1.0056 |
2.4987 |
4.4744 |
3.5916 |
| 1.7265 |
4.6802 |
5.4193 |
| H8 |
2.5743 |
2.0830 |
1.0036 |
3.1664 |
3.8956 |
2.3200 |
1.7265 |
| 4.4865 |
4.6048 |
| H9 |
2.0897 |
2.6615 |
4.0004 |
2.5557 |
1.0821 |
3.0602 |
4.6802 |
4.4865 |
| 1.8554 |
| H10 |
2.1078 |
3.4604 |
4.5143 |
3.9305 |
1.0815 |
2.4533 |
5.4193 |
4.6048 |
1.8554 |
|
Maximum atom distance is 5.4193Å
between atoms H7 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
N3 |
114.196 |
|
C1 |
C2 |
O4 |
123.245 |
|
C2 |
C1 |
C5 |
120.925 |
|
N3 |
C2 |
O4 |
122.550 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C5 |
H9 |
120.052 |
|
C1 |
C5 |
H10 |
121.862 |
|
C2 |
C1 |
H6 |
118.215 |
|
C2 |
N3 |
H7 |
118.038 |
|
C2 |
N3 |
H8 |
122.230 |
|
C5 |
C1 |
H6 |
120.860 |
|
H7 |
N3 |
H8 |
118.480 |
|
H9 |
C5 |
H10 |
118.086 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.