|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF2CHF2 (1,1,2,2-tetrafluoroethane)
1AG C2H
1910171554
InChI=1S/C2H2F4/c3-1(4)2(5)6/h1-2H INChIKey=WXGNWUVNYMJENI-UHFFFAOYSA-N
CCSD/cc-pVTZ
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.2434 |
0.7196 |
0.0000 |
|
0.6825 |
0.0000 |
-0.3337 |
| C2 |
0.2434 |
-0.7196 |
0.0000 |
|
-0.6825 |
0.0000 |
0.3337 |
| H3 |
-1.3303 |
0.7781 |
0.0000 |
|
0.6010 |
0.0000 |
-1.4191 |
| H4 |
1.3303 |
-0.7781 |
0.0000 |
|
-0.6010 |
0.0000 |
1.4191 |
| F5 |
0.2434 |
1.3391 |
1.0919 |
|
1.3592 |
1.0919 |
0.0696 |
| F6 |
0.2434 |
1.3391 |
-1.0919 |
|
1.3592 |
-1.0919 |
0.0696 |
| F7 |
-0.2434 |
-1.3391 |
1.0919 |
|
-1.3592 |
1.0919 |
-0.0696 |
| F8 |
-0.2434 |
-1.3391 |
-1.0919 |
|
-1.3592 |
-1.0919 |
-0.0696 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
F5 |
F6 |
F7 |
F8 |
| C1 |
|
1.5193 |
1.0885 |
2.1725 |
1.3464 |
1.3464 |
2.3303 |
2.3303 |
| C2 |
1.5193 |
| 2.1725 |
1.0885 |
2.3303 |
2.3303 |
1.3464 |
1.3464 |
| H3 |
1.0885 |
2.1725 |
| 3.0823 |
1.9958 |
1.9958 |
2.6184 |
2.6184 |
| H4 |
2.1725 |
1.0885 |
3.0823 |
| 2.6184 |
2.6184 |
1.9958 |
1.9958 |
| F5 |
1.3464 |
2.3303 |
1.9958 |
2.6184 |
| 2.1837 |
2.7220 |
3.4897 |
| F6 |
1.3464 |
2.3303 |
1.9958 |
2.6184 |
2.1837 |
| 3.4897 |
2.7220 |
| F7 |
2.3303 |
1.3464 |
2.6184 |
1.9958 |
2.7220 |
3.4897 |
| 2.1837 |
| F8 |
2.3303 |
1.3464 |
2.6184 |
1.9958 |
3.4897 |
2.7220 |
2.1837 |
|
Maximum atom distance is 3.4897Å
between atoms F5 and F8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F7 |
108.664 |
|
C1 |
C2 |
F8 |
108.664 |
|
C2 |
C1 |
F5 |
108.664 |
|
C2 |
C1 |
F6 |
108.664 |
|
F5 |
C1 |
F6 |
108.378 |
|
F7 |
C2 |
F8 |
108.378 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H4 |
111.765 |
|
C2 |
C1 |
H3 |
111.765 |
|
H3 |
C1 |
F5 |
109.649 |
|
H3 |
C1 |
F6 |
109.649 |
|
H4 |
C2 |
F7 |
109.649 |
|
H4 |
C2 |
F8 |
109.649 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.