|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COOCH3 (methyl acetate)
1A' CS
1910171554
InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3 INChIKey=KXKVLQRXCPHEJC-UHFFFAOYSA-N
B3LYP/cc-pVTZ
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
1.1289 |
1.4911 |
0.0000 |
|
1.7734 |
0.5942 |
0.0000 |
| C2 |
0.0000 |
0.4950 |
0.0000 |
|
0.4691 |
-0.1579 |
0.0000 |
| O3 |
-1.1736 |
0.7644 |
0.0000 |
|
0.3500 |
-1.3562 |
0.0000 |
| O4 |
0.4725 |
-0.7703 |
0.0000 |
|
-0.5793 |
0.6936 |
0.0000 |
| C5 |
-0.5218 |
-1.8067 |
0.0000 |
|
-1.8788 |
0.0819 |
0.0000 |
| H6 |
0.7234 |
2.4978 |
0.0000 |
|
2.5980 |
-0.1114 |
0.0000 |
| H7 |
1.7573 |
1.3416 |
0.8780 |
|
1.8321 |
1.2375 |
0.8780 |
| H8 |
1.7573 |
1.3416 |
-0.8780 |
|
1.8321 |
1.2375 |
-0.8780 |
| H9 |
0.0296 |
-2.7421 |
0.0000 |
|
-2.5893 |
0.9029 |
0.0000 |
| H10 |
-1.1508 |
-1.7340 |
0.8856 |
|
-2.0105 |
-0.5374 |
0.8856 |
| H11 |
-1.1508 |
-1.7340 |
-0.8856 |
|
-2.0105 |
-0.5374 |
-0.8856 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
O4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5056 |
2.4145 |
2.3547 |
3.6879 |
1.0853 |
1.0900 |
1.0900 |
4.3736 |
4.0475 |
4.0475 |
| C2 |
1.5056 |
|
1.2042 |
1.3506 |
2.3601 |
2.1294 |
2.1391 |
2.1391 |
3.2372 |
2.6602 |
2.6602 |
| O3 |
2.4145 |
1.2042 |
| 2.2506 |
2.6525 |
2.5696 |
3.1136 |
3.1136 |
3.7072 |
2.6508 |
2.6508 |
| O4 |
2.3547 |
1.3506 |
2.2506 |
|
1.4363 |
3.2777 |
2.6233 |
2.6233 |
2.0209 |
2.0852 |
2.0852 |
| C5 |
3.6879 |
2.3601 |
2.6525 |
1.4363 |
| 4.4810 |
3.9846 |
3.9846 |
1.0857 |
1.0887 |
1.0887 |
| H6 |
1.0853 |
2.1294 |
2.5696 |
3.2777 |
4.4810 |
| 1.7823 |
1.7823 |
5.2855 |
4.7121 |
4.7121 |
| H7 |
1.0900 |
2.1391 |
3.1136 |
2.6233 |
3.9846 |
1.7823 |
| 1.7560 |
4.5202 |
4.2327 |
4.5855 |
| H8 |
1.0900 |
2.1391 |
3.1136 |
2.6233 |
3.9846 |
1.7823 |
1.7560 |
| 4.5202 |
4.5855 |
4.2327 |
| H9 |
4.3736 |
3.2372 |
3.7072 |
2.0209 |
1.0857 |
5.2855 |
4.5202 |
4.5202 |
| 1.7872 |
1.7872 |
| H10 |
4.0475 |
2.6602 |
2.6508 |
2.0852 |
1.0887 |
4.7121 |
4.2327 |
4.5855 |
1.7872 |
| 1.7713 |
| H11 |
4.0475 |
2.6602 |
2.6508 |
2.0852 |
1.0887 |
4.7121 |
4.5855 |
4.2327 |
1.7872 |
1.7713 |
|
Maximum atom distance is 5.2855Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
125.648 |
|
C1 |
C2 |
O4 |
110.946 |
|
C2 |
O4 |
C5 |
115.712 |
|
O3 |
C2 |
O4 |
123.406 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H6 |
109.478 |
|
C2 |
C1 |
H7 |
109.969 |
|
C2 |
C1 |
H8 |
109.969 |
|
O4 |
C5 |
H9 |
105.669 |
|
O4 |
C5 |
H10 |
110.592 |
|
O4 |
C5 |
H11 |
110.592 |
|
H6 |
C1 |
H7 |
110.041 |
|
H6 |
C1 |
H8 |
110.041 |
|
H7 |
C1 |
H8 |
107.318 |
|
H9 |
C5 |
H10 |
110.549 |
|
H9 |
C5 |
H11 |
110.549 |
|
H10 |
C5 |
H11 |
108.872 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.