|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF2CH2F (Ethane, 1,1,2-trifluoro)
1A C1
1910171554
InChI=1S/C2H3F3/c3-1-2(4)5/h2H,1H2 INChIKey=WGZYQOSEVSXDNI-UHFFFAOYSA-N
B1B95/cc-pVTZ
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.7731 |
-0.5814 |
-0.2857 |
|
-0.7520 |
-0.5949 |
-0.3130 |
| C2 |
0.4647 |
0.0198 |
0.3254 |
|
0.4589 |
0.0241 |
0.3333 |
| F3 |
-1.8722 |
0.1097 |
0.1530 |
|
-1.8767 |
0.0540 |
0.1255 |
| F4 |
1.5214 |
-0.7610 |
-0.0052 |
|
1.5420 |
-0.7183 |
-0.0002 |
| F5 |
0.6852 |
1.2515 |
-0.1808 |
|
0.6526 |
1.2743 |
-0.1375 |
| H6 |
-0.7094 |
-0.5117 |
-1.3704 |
|
-0.6735 |
-0.4951 |
-1.3944 |
| H7 |
-0.8583 |
-1.6229 |
0.0189 |
|
-0.8127 |
-1.6459 |
-0.0367 |
| H8 |
0.4086 |
0.1018 |
1.4106 |
|
0.3838 |
0.0761 |
1.4192 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
F3 |
F4 |
F5 |
H6 |
H7 |
H8 |
| C1 |
|
1.5057 |
1.3705 |
2.3185 |
2.3446 |
1.0888 |
1.0885 |
2.1773 |
| C2 |
1.5057 |
| 2.3449 |
1.3548 |
1.3498 |
2.1299 |
2.1314 |
1.0898 |
| F3 |
1.3705 |
2.3449 |
| 3.5071 |
2.8205 |
2.0147 |
2.0119 |
2.6045 |
| F4 |
2.3185 |
1.3548 |
3.5071 |
| 2.1864 |
2.6272 |
2.5311 |
1.9968 |
| F5 |
2.3446 |
1.3498 |
2.8205 |
2.1864 |
| 2.5434 |
3.2688 |
1.9827 |
| H6 |
1.0888 |
2.1299 |
2.0147 |
2.6272 |
2.5434 |
| 1.7852 |
3.0595 |
| H7 |
1.0885 |
2.1314 |
2.0119 |
2.5311 |
3.2688 |
1.7852 |
| 2.5528 |
| H8 |
2.1773 |
1.0898 |
2.6045 |
1.9968 |
1.9827 |
3.0595 |
2.5528 |
|
Maximum atom distance is 3.5071Å
between atoms F3 and F4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F4 |
108.180 |
|
C1 |
C2 |
F5 |
110.271 |
|
C2 |
C1 |
F3 |
109.146 |
|
F4 |
C2 |
F5 |
107.874 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H8 |
113.076 |
|
C2 |
C1 |
H6 |
109.311 |
|
C2 |
C1 |
H7 |
109.442 |
|
F3 |
C1 |
H6 |
109.486 |
|
F3 |
C1 |
H7 |
109.278 |
|
F4 |
C2 |
H8 |
109.058 |
|
F5 |
C2 |
H8 |
108.252 |
|
H6 |
C1 |
H7 |
110.160 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.