|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C3H2O2 (Propiolic acid)
1A' CS
1910171554
InChI=1S/C3H2O2/c1-2-3(4)5/h1H,(H,4,5) INChIKey=UORVCLMRJXCDCP-UHFFFAOYSA-N
B2PLYP=FULLultrafine/cc-pVTZ
Point group is Cs
| Atom |
Internal |
| x (Å) |
y (Å) |
z (Å) |
| C1 |
0.0000 |
0.4887 |
0.0000 |
| C2 |
-0.2259 |
-0.9373 |
0.0000 |
| C3 |
-0.4738 |
-2.1145 |
0.0000 |
| O4 |
1.3148 |
0.7819 |
0.0000 |
| O5 |
-0.8757 |
1.3160 |
0.0000 |
| H6 |
-0.6905 |
-3.1516 |
0.0000 |
| H7 |
1.3762 |
1.7482 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
O5 |
H6 |
H7 |
| C1 |
|
1.4438 |
2.6460 |
1.3471 |
1.2047 |
3.7052 |
1.8656 |
| C2 |
1.4438 |
|
1.2030 |
2.3085 |
2.3451 |
2.2625 |
3.1271 |
| C3 |
2.6460 |
1.2030 |
| 3.4041 |
3.4540 |
1.0595 |
4.2829 |
| O4 |
1.3471 |
2.3085 |
3.4041 |
| 2.2547 |
4.4151 |
0.9683 |
| O5 |
1.2047 |
2.3451 |
3.4540 |
2.2547 |
| 4.4714 |
2.2931 |
| H6 |
3.7052 |
2.2625 |
1.0595 |
4.4151 |
4.4714 |
| 5.3179 |
| H7 |
1.8656 |
3.1271 |
4.2829 |
0.9683 |
2.2931 |
5.3179 |
|
Maximum atom distance is 5.3179Å
between atoms H6 and H7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
177.113 |
|
C2 |
C1 |
O4 |
111.573 |
|
C2 |
C1 |
O5 |
124.368 |
|
O4 |
C1 |
O5 |
124.058 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
O4 |
H7 |
106.208 |
|
C2 |
C3 |
H6 |
179.914 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.