|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COOH (Acetic acid)
1A' CS
1910171554
InChI=1S/C2H4O2/c1-2(3)4/h1H3,(H,3,4) INChIKey=QTBSBXVTEAMEQO-UHFFFAOYSA-N
MP2/cc-pVTZ
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
1.3892 |
-0.1068 |
-0.0000 |
|
-1.1002 |
-0.8548 |
-0.0000 |
| C2 |
-0.0906 |
0.1260 |
-0.0000 |
|
0.1518 |
-0.0323 |
-0.0000 |
| O3 |
-0.6452 |
1.1993 |
0.0000 |
|
1.2839 |
-0.4542 |
0.0000 |
| H4 |
1.9049 |
0.8457 |
-0.0007 |
|
-0.8417 |
-1.9066 |
-0.0007 |
| H5 |
1.6673 |
-0.6851 |
0.8778 |
|
-1.6949 |
-0.6136 |
0.8778 |
| H6 |
1.6672 |
-0.6864 |
-0.8770 |
|
-1.6957 |
-0.6126 |
-0.8770 |
| O7 |
-0.7703 |
-1.0479 |
-0.0000 |
|
-0.1341 |
1.2936 |
-0.0000 |
| H8 |
-1.7069 |
-0.8009 |
0.0001 |
|
0.7253 |
1.7404 |
0.0001 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
H4 |
H5 |
H6 |
O7 |
H8 |
| C1 |
|
1.4980 |
2.4175 |
1.0831 |
1.0874 |
1.0874 |
2.3556 |
3.1729 |
| C2 |
1.4980 |
|
1.2081 |
2.1213 |
2.1257 |
2.1258 |
1.3564 |
1.8631 |
| O3 |
2.4175 |
1.2081 |
| 2.5744 |
3.1095 |
3.1100 |
2.2507 |
2.2645 |
| H4 |
1.0831 |
2.1213 |
2.5744 |
| 1.7809 |
1.7809 |
3.2775 |
3.9693 |
| H5 |
1.0874 |
2.1257 |
3.1095 |
1.7809 |
| 1.7548 |
2.6161 |
3.4884 |
| H6 |
1.0874 |
2.1258 |
3.1100 |
1.7809 |
1.7548 |
| 2.6156 |
3.4881 |
| O7 |
2.3556 |
1.3564 |
2.2507 |
3.2775 |
2.6161 |
2.6156 |
|
0.9686 |
| H8 |
3.1729 |
1.8631 |
2.2645 |
3.9693 |
3.4884 |
3.4881 |
0.9686 |
|
Maximum atom distance is 3.9693Å
between atoms H4 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
126.261 |
|
C1 |
C2 |
O7 |
111.133 |
|
O3 |
C2 |
O7 |
122.605 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H4 |
109.493 |
|
C2 |
C1 |
H5 |
109.592 |
|
C2 |
C1 |
H6 |
109.597 |
|
C2 |
O7 |
H8 |
105.300 |
|
H4 |
C1 |
H5 |
110.268 |
|
H4 |
C1 |
H6 |
110.272 |
|
H5 |
C1 |
H6 |
107.592 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.