|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH2CCl2 (Ethene, 1,1-dichloro-)
1A1 C2V
1910171554
InChI=1S/C2H2Cl2/c1-2(3)4/h1H2 INChIKey=LGXVIGDEPROXKC-UHFFFAOYSA-N
QCISD/6-311G*
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
1.7495 |
|
1.7495 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
0.0000 |
0.4162 |
|
0.4162 |
0.0000 |
0.0000 |
| H3 |
0.0000 |
0.9349 |
2.2997 |
|
2.2997 |
0.0000 |
0.9349 |
| H4 |
0.0000 |
-0.9349 |
2.2997 |
|
2.2997 |
0.0000 |
-0.9349 |
| Cl5 |
0.0000 |
1.4612 |
-0.5174 |
|
-0.5174 |
0.0000 |
1.4612 |
| Cl6 |
0.0000 |
-1.4612 |
-0.5174 |
|
-0.5174 |
0.0000 |
-1.4612 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
Cl5 |
Cl6 |
| C1 |
|
1.3333 |
1.0848 |
1.0848 |
2.6970 |
2.6970 |
| C2 |
1.3333 |
| 2.1028 |
2.1028 |
1.7340 |
1.7340 |
| H3 |
1.0848 |
2.1028 |
| 1.8698 |
2.8659 |
3.6983 |
| H4 |
1.0848 |
2.1028 |
1.8698 |
| 3.6983 |
2.8659 |
| Cl5 |
2.6970 |
1.7340 |
2.8659 |
3.6983 |
| 2.9225 |
| Cl6 |
2.6970 |
1.7340 |
3.6983 |
2.8659 |
2.9225 |
|
Maximum atom distance is 3.6983Å
between atoms H3 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
Cl5 |
122.575 |
|
C1 |
C2 |
Cl6 |
122.575 |
|
Cl5 |
C2 |
Cl6 |
114.850 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H3 |
120.478 |
|
C2 |
C1 |
H4 |
120.478 |
|
H3 |
C1 |
H4 |
119.044 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.