|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6N4 (Tetracyanoethylene)
1AG D2H
1910171554
InChI=1S/C6N4/c7-1-5(2-8)6(3-9)4-10 INChIKey=NLDYACGHTUPAQU-UHFFFAOYSA-N
CID/6-311G*
Point group is D2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.6696 |
|
0.6696 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
0.0000 |
-0.6696 |
|
-0.6696 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2198 |
1.4228 |
|
1.4228 |
0.0000 |
1.2198 |
| C4 |
0.0000 |
-1.2198 |
1.4228 |
|
1.4228 |
0.0000 |
-1.2198 |
| C5 |
0.0000 |
1.2198 |
-1.4228 |
|
-1.4228 |
0.0000 |
1.2198 |
| C6 |
0.0000 |
-1.2198 |
-1.4228 |
|
-1.4228 |
0.0000 |
-1.2198 |
| N7 |
0.0000 |
2.1815 |
2.0329 |
|
2.0329 |
0.0000 |
2.1815 |
| N8 |
0.0000 |
-2.1815 |
2.0329 |
|
2.0329 |
0.0000 |
-2.1815 |
| N9 |
0.0000 |
2.1815 |
-2.0329 |
|
-2.0329 |
0.0000 |
2.1815 |
| N10 |
0.0000 |
-2.1815 |
-2.0329 |
|
-2.0329 |
0.0000 |
-2.1815 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
N7 |
N8 |
N9 |
N10 |
| C1 |
|
1.3391 |
1.4336 |
1.4336 |
2.4219 |
2.4219 |
2.5725 |
2.5725 |
3.4731 |
3.4731 |
| C2 |
1.3391 |
| 2.4219 |
2.4219 |
1.4336 |
1.4336 |
3.4731 |
3.4731 |
2.5725 |
2.5725 |
| C3 |
1.4336 |
2.4219 |
| 2.4395 |
2.8456 |
3.7481 |
1.1389 |
3.4555 |
3.5870 |
4.8487 |
| C4 |
1.4336 |
2.4219 |
2.4395 |
| 3.7481 |
2.8456 |
3.4555 |
1.1389 |
4.8487 |
3.5870 |
| C5 |
2.4219 |
1.4336 |
2.8456 |
3.7481 |
| 2.4395 |
3.5870 |
4.8487 |
1.1389 |
3.4555 |
| C6 |
2.4219 |
1.4336 |
3.7481 |
2.8456 |
2.4395 |
| 4.8487 |
3.5870 |
3.4555 |
1.1389 |
| N7 |
2.5725 |
3.4731 |
1.1389 |
3.4555 |
3.5870 |
4.8487 |
| 4.3630 |
4.0657 |
5.9637 |
| N8 |
2.5725 |
3.4731 |
3.4555 |
1.1389 |
4.8487 |
3.5870 |
4.3630 |
| 5.9637 |
4.0657 |
| N9 |
3.4731 |
2.5725 |
3.5870 |
4.8487 |
1.1389 |
3.4555 |
4.0657 |
5.9637 |
| 4.3630 |
| N10 |
3.4731 |
2.5725 |
4.8487 |
3.5870 |
3.4555 |
1.1389 |
5.9637 |
4.0657 |
4.3630 |
|
Maximum atom distance is 5.9637Å
between atoms N7 and N10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C5 |
121.695 |
|
C1 |
C2 |
C6 |
121.695 |
|
C1 |
C3 |
N7 |
179.306 |
|
C1 |
C4 |
N8 |
179.306 |
|
C2 |
C1 |
C3 |
121.695 |
|
C2 |
C1 |
C4 |
121.695 |
|
C2 |
C5 |
N9 |
179.306 |
|
C2 |
C6 |
N10 |
179.306 |
|
C3 |
C1 |
C4 |
116.609 |
|
C5 |
C2 |
C6 |
116.609 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.