|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CONH2 (Acetamide)
1A' C1
1910171554
InChI=1S/C2H5NO/c1-2(3)4/h1H3,(H2,3,4) INChIKey=DLFVBJFMPXGRIB-UHFFFAOYSA-N
BLYP/6-311G*
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-1.3748 |
-0.3443 |
-0.0000 |
|
1.3997 |
-0.2221 |
-0.0014 |
| C2 |
0.0783 |
0.1497 |
-0.0002 |
|
-0.0912 |
0.1422 |
-0.0003 |
| N3 |
1.0394 |
-0.8398 |
-0.0006 |
|
-0.9615 |
-0.9279 |
0.0021 |
| O4 |
0.3653 |
1.3435 |
0.0001 |
|
-0.4821 |
1.3062 |
-0.0014 |
| H5 |
-1.8871 |
0.0686 |
-0.8797 |
|
1.8726 |
0.2330 |
-0.8824 |
| H6 |
-1.4852 |
-1.4380 |
-0.0074 |
|
1.6059 |
-1.3018 |
-0.0073 |
| H7 |
-1.8829 |
0.0561 |
0.8879 |
|
1.8718 |
0.2229 |
0.8852 |
| H8 |
2.0157 |
-0.5601 |
0.0017 |
|
-1.9586 |
-0.7352 |
0.0053 |
| H9 |
0.8197 |
-1.8288 |
0.0020 |
|
-0.6557 |
-1.8938 |
0.0059 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
N3 |
O4 |
H5 |
H6 |
H7 |
H8 |
H9 |
| C1 |
|
1.5348 |
2.4645 |
2.4242 |
1.0985 |
1.0993 |
1.0986 |
3.3973 |
2.6494 |
| C2 |
1.5348 |
|
1.3794 |
1.2278 |
2.1547 |
2.2283 |
2.1550 |
2.0633 |
2.1128 |
| N3 |
2.4645 |
1.3794 |
| 2.2850 |
3.1878 |
2.5945 |
3.1831 |
1.0156 |
1.0131 |
| O4 |
2.4242 |
1.2278 |
2.2850 |
| 2.7336 |
3.3409 |
2.7387 |
2.5194 |
3.2047 |
| H5 |
1.0985 |
2.1547 |
3.1878 |
2.7336 |
| 1.7867 |
1.7676 |
4.0501 |
3.4212 |
| H6 |
1.0993 |
2.2283 |
2.5945 |
3.3409 |
1.7867 |
| 1.7867 |
3.6092 |
2.3378 |
| H7 |
1.0986 |
2.1550 |
3.1831 |
2.7387 |
1.7676 |
1.7867 |
| 4.0452 |
3.4120 |
| H8 |
3.3973 |
2.0633 |
1.0156 |
2.5194 |
4.0501 |
3.6092 |
4.0452 |
| 1.7435 |
| H9 |
2.6494 |
2.1128 |
1.0131 |
3.2047 |
3.4212 |
2.3378 |
3.4120 |
1.7435 |
|
Maximum atom distance is 4.0501Å
between atoms H5 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
N3 |
115.388 |
|
C1 |
C2 |
O4 |
122.295 |
|
N3 |
C2 |
O4 |
122.317 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H5 |
108.689 |
|
C2 |
C1 |
H6 |
114.540 |
|
C2 |
C1 |
H7 |
108.705 |
|
C2 |
N3 |
H8 |
118.179 |
|
C2 |
N3 |
H9 |
123.313 |
|
H5 |
C1 |
H6 |
108.772 |
|
H5 |
C1 |
H7 |
107.126 |
|
H6 |
C1 |
H7 |
108.760 |
|
H8 |
N3 |
H9 |
118.507 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.