|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH5N3S (Hydrazinecarbothioamide)
1A C1
1910171554
InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) INChIKey=BRWIZMBXBAOCCF-UHFFFAOYSA-N
B1B95/6-311G*
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| H1 |
0.6079 |
-1.6771 |
0.0030 |
|
-0.6099 |
-1.6763 |
0.0152 |
| N2 |
0.8566 |
-0.7001 |
-0.0074 |
|
-0.8574 |
-0.6991 |
-0.0026 |
| S3 |
-1.7551 |
-0.3533 |
0.0015 |
|
1.7547 |
-0.3552 |
0.0051 |
| C4 |
-0.1731 |
0.1860 |
-0.0016 |
|
0.1733 |
0.1858 |
-0.0029 |
| H5 |
1.1671 |
1.7158 |
-0.0028 |
|
-1.1651 |
1.7170 |
-0.0163 |
| H6 |
-0.5277 |
2.1735 |
-0.0001 |
|
0.5302 |
2.1728 |
-0.0161 |
| N7 |
0.1893 |
1.4742 |
-0.0004 |
|
-0.1876 |
1.4744 |
-0.0115 |
| H8 |
2.6658 |
-0.6059 |
-0.8169 |
|
-2.6661 |
-0.6089 |
-0.8138 |
| H9 |
2.6519 |
-0.6001 |
0.8342 |
|
-2.6530 |
-0.5908 |
0.8372 |
| N10 |
2.1763 |
-0.2699 |
0.0033 |
|
-2.1766 |
-0.2674 |
0.0042 |
Atom - Atom Distances (Å)
| |
H1 |
N2 |
S3 |
C4 |
H5 |
H6 |
N7 |
H8 |
H9 |
N10 |
| H1 |
|
1.0082 |
2.7086 |
2.0202 |
3.4386 |
4.0145 |
3.1790 |
2.4606 |
2.4553 |
2.1071 |
| N2 |
1.0082 |
| 2.6347 |
1.3585 |
2.4357 |
3.1896 |
2.2744 |
1.9843 |
1.9853 |
1.3881 |
| S3 |
2.7086 |
2.6347 |
| 1.6714 |
3.5806 |
2.8091 |
2.6684 |
4.5031 |
4.4918 |
3.9323 |
| C4 |
2.0202 |
1.3585 |
1.6714 |
| 2.0338 |
2.0189 |
1.3382 |
3.0580 |
3.0492 |
2.3933 |
| H5 |
3.4386 |
2.4357 |
3.5806 |
2.0338 |
| 1.7556 |
1.0072 |
2.8808 |
2.8755 |
2.2274 |
| H6 |
4.0145 |
3.1896 |
2.8091 |
2.0189 |
1.7556 |
|
1.0016 |
4.3117 |
4.3011 |
3.6445 |
| N7 |
3.1790 |
2.2744 |
2.6684 |
1.3382 |
1.0072 |
1.0016 |
| 3.3357 |
3.3262 |
2.6439 |
| H8 |
2.4606 |
1.9843 |
4.5031 |
3.0580 |
2.8808 |
4.3117 |
3.3357 |
| 1.6512 |
1.0126 |
| H9 |
2.4553 |
1.9853 |
4.4918 |
3.0492 |
2.8755 |
4.3011 |
3.3262 |
1.6512 |
|
1.0127 |
| N10 |
2.1071 |
1.3881 |
3.9323 |
2.3933 |
2.2274 |
3.6445 |
2.6439 |
1.0126 |
1.0127 |
|
Maximum atom distance is 4.5031Å
between atoms S3 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C4 |
S3 |
120.464 |
|
N2 |
C4 |
N7 |
114.997 |
|
S3 |
C4 |
N7 |
124.539 |
|
C4 |
N2 |
N10 |
121.232 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H1 |
N2 |
C4 |
116.428 |
|
H1 |
N2 |
N10 |
122.324 |
|
N2 |
N10 |
H8 |
110.521 |
|
N2 |
N10 |
H9 |
110.599 |
|
C4 |
N7 |
H5 |
119.591 |
|
C4 |
N7 |
H6 |
118.566 |
|
H5 |
N7 |
H6 |
121.843 |
|
H8 |
N10 |
H9 |
109.232 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.