|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH5N3S (Hydrazinecarbothioamide)
1A C1
1910171554
InChI=1S/CH5N3S/c2-1(5)4-3/h3H2,(H3,2,4,5) INChIKey=BRWIZMBXBAOCCF-UHFFFAOYSA-N
HF/6-311G*
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| H1 |
0.6275 |
-1.6504 |
0.0005 |
|
0.5872 |
-1.6651 |
0.0005 |
| N2 |
0.8612 |
-0.6863 |
0.0000 |
|
0.8443 |
-0.7070 |
0.0000 |
| S3 |
-1.7522 |
-0.3620 |
-0.0000 |
|
-1.7604 |
-0.3193 |
-0.0000 |
| C4 |
-0.1564 |
0.1883 |
-0.0000 |
|
-0.1518 |
0.1920 |
-0.0000 |
| H5 |
1.1205 |
1.7546 |
0.0001 |
|
1.1628 |
1.7268 |
0.0001 |
| H6 |
-0.5575 |
2.1440 |
-0.0002 |
|
-0.5052 |
2.1569 |
-0.0002 |
| N7 |
0.1698 |
1.4737 |
0.0000 |
|
0.2056 |
1.4691 |
0.0000 |
| H8 |
2.6494 |
-0.6047 |
-0.8148 |
|
2.6339 |
-0.6689 |
-0.8148 |
| H9 |
2.6495 |
-0.6041 |
0.8148 |
|
2.6340 |
-0.6683 |
0.8148 |
| N10 |
2.1810 |
-0.2698 |
-0.0001 |
|
2.1738 |
-0.3227 |
-0.0001 |
Atom - Atom Distances (Å)
| |
H1 |
N2 |
S3 |
C4 |
H5 |
H6 |
N7 |
H8 |
H9 |
N10 |
| H1 |
|
0.9920 |
2.7060 |
1.9987 |
3.4405 |
3.9751 |
3.1574 |
2.4179 |
2.4179 |
2.0783 |
| N2 |
0.9920 |
| 2.6334 |
1.3418 |
2.4546 |
3.1659 |
2.2679 |
1.9667 |
1.9669 |
1.3840 |
| S3 |
2.7060 |
2.6334 |
| 1.6880 |
3.5683 |
2.7762 |
2.6578 |
4.4829 |
4.4830 |
3.9343 |
| C4 |
1.9987 |
1.3418 |
1.6880 |
| 2.0209 |
1.9964 |
1.3262 |
3.0274 |
3.0273 |
2.3819 |
| H5 |
3.4405 |
2.4546 |
3.5683 |
2.0209 |
| 1.7226 |
0.9914 |
2.9270 |
2.9266 |
2.2853 |
| H6 |
3.9751 |
3.1659 |
2.7762 |
1.9964 |
1.7226 |
|
0.9891 |
4.3015 |
4.3013 |
3.6505 |
| N7 |
3.1574 |
2.2679 |
2.6578 |
1.3262 |
0.9914 |
0.9891 |
| 3.3364 |
3.3361 |
2.6617 |
| H8 |
2.4179 |
1.9667 |
4.4829 |
3.0274 |
2.9270 |
4.3015 |
3.3364 |
| 1.6296 |
0.9976 |
| H9 |
2.4179 |
1.9669 |
4.4830 |
3.0273 |
2.9266 |
4.3013 |
3.3361 |
1.6296 |
|
0.9976 |
| N10 |
2.0783 |
1.3840 |
3.9343 |
2.3819 |
2.2853 |
3.6505 |
2.6617 |
0.9976 |
0.9976 |
|
Maximum atom distance is 4.4830Å
between atoms S3 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N2 |
C4 |
S3 |
120.298 |
|
N2 |
C4 |
N7 |
116.435 |
|
S3 |
C4 |
N7 |
123.266 |
|
C4 |
N2 |
N10 |
121.810 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H1 |
N2 |
C4 |
117.049 |
|
H1 |
N2 |
N10 |
121.141 |
|
N2 |
N10 |
H8 |
110.288 |
|
N2 |
N10 |
H9 |
110.299 |
|
C4 |
N7 |
H5 |
120.702 |
|
C4 |
N7 |
H6 |
118.423 |
|
H5 |
N7 |
H6 |
120.875 |
|
H8 |
N10 |
H9 |
109.518 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.