|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C4H6O2 (2,3-Butanedione)
1Ag C2H
1910171554
InChI=1S/C4H6O2/c1-3(5)4(2)6/h1-2H3 INChIKey=QSJXEFYPDANLFS-UHFFFAOYSA-N
CISD/6-311G*
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.0822 |
0.7659 |
0.0000 |
|
0.7667 |
0.0749 |
0.0000 |
| C2 |
0.0822 |
-0.7659 |
0.0000 |
|
-0.7667 |
-0.0749 |
0.0000 |
| C3 |
1.1826 |
1.5748 |
0.0000 |
|
1.3022 |
1.4775 |
0.0000 |
| C4 |
-1.1826 |
-1.5748 |
0.0000 |
|
-1.3022 |
-1.4775 |
0.0000 |
| O5 |
-1.1826 |
1.2354 |
0.0000 |
|
1.4496 |
-0.9075 |
0.0000 |
| O6 |
1.1826 |
-1.2354 |
0.0000 |
|
-1.4496 |
0.9075 |
0.0000 |
| H7 |
0.9341 |
2.6291 |
0.0000 |
|
2.3850 |
1.4479 |
0.0000 |
| H8 |
-0.9341 |
-2.6291 |
0.0000 |
|
-2.3850 |
-1.4479 |
0.0000 |
| H9 |
1.7838 |
1.3309 |
0.8715 |
|
0.9414 |
2.0167 |
0.8715 |
| H10 |
1.7838 |
1.3309 |
-0.8715 |
|
0.9414 |
2.0167 |
-0.8715 |
| H11 |
-1.7838 |
-1.3309 |
0.8715 |
|
-0.9414 |
-2.0167 |
0.8715 |
| H12 |
-1.7838 |
-1.3309 |
-0.8715 |
|
-0.9414 |
-2.0167 |
-0.8715 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
O5 |
O6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
|
1.5407 |
1.5014 |
2.5865 |
1.1964 |
2.3675 |
2.1223 |
3.5002 |
2.1355 |
2.1355 |
2.8375 |
2.8375 |
| C2 |
1.5407 |
| 2.5865 |
1.5014 |
2.3675 |
1.1964 |
3.5002 |
2.1223 |
2.8375 |
2.8375 |
2.1355 |
2.1355 |
| C3 |
1.5014 |
2.5865 |
| 3.9389 |
2.3895 |
2.8102 |
1.0832 |
4.7067 |
1.0864 |
1.0864 |
4.2429 |
4.2429 |
| C4 |
2.5865 |
1.5014 |
3.9389 |
| 2.8102 |
2.3895 |
4.7067 |
1.0832 |
4.2429 |
4.2429 |
1.0864 |
1.0864 |
| O5 |
1.1964 |
2.3675 |
2.3895 |
2.8102 |
| 3.4204 |
2.5343 |
3.8724 |
3.0933 |
3.0933 |
2.7760 |
2.7760 |
| O6 |
2.3675 |
1.1964 |
2.8102 |
2.3895 |
3.4204 |
| 3.8724 |
2.5343 |
2.7760 |
2.7760 |
3.0933 |
3.0933 |
| H7 |
2.1223 |
3.5002 |
1.0832 |
4.7067 |
2.5343 |
3.8724 |
| 5.5801 |
1.7796 |
1.7796 |
4.8813 |
4.8813 |
| H8 |
3.5002 |
2.1223 |
4.7067 |
1.0832 |
3.8724 |
2.5343 |
5.5801 |
| 4.8813 |
4.8813 |
1.7796 |
1.7796 |
| H9 |
2.1355 |
2.8375 |
1.0864 |
4.2429 |
3.0933 |
2.7760 |
1.7796 |
4.8813 |
| 1.7430 |
4.4511 |
4.7802 |
| H10 |
2.1355 |
2.8375 |
1.0864 |
4.2429 |
3.0933 |
2.7760 |
1.7796 |
4.8813 |
1.7430 |
| 4.7802 |
4.4511 |
| H11 |
2.8375 |
2.1355 |
4.2429 |
1.0864 |
2.7760 |
3.0933 |
4.8813 |
1.7796 |
4.4511 |
4.7802 |
| 1.7430 |
| H12 |
2.8375 |
2.1355 |
4.2429 |
1.0864 |
2.7760 |
3.0933 |
4.8813 |
1.7796 |
4.7802 |
4.4511 |
1.7430 |
|
Maximum atom distance is 5.5801Å
between atoms H7 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
116.474 |
|
C1 |
C2 |
O6 |
119.228 |
|
C2 |
C1 |
C3 |
116.474 |
|
C2 |
C1 |
O5 |
119.228 |
|
C3 |
C1 |
O5 |
124.298 |
|
C4 |
C2 |
O6 |
124.298 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H7 |
109.331 |
|
C1 |
C3 |
H9 |
110.192 |
|
C1 |
C3 |
H10 |
110.192 |
|
C2 |
C4 |
H8 |
109.331 |
|
C2 |
C4 |
H11 |
110.192 |
|
C2 |
C4 |
H12 |
110.192 |
|
H7 |
C3 |
H9 |
110.215 |
|
H7 |
C3 |
H10 |
110.215 |
|
H8 |
C4 |
H11 |
110.215 |
|
H8 |
C4 |
H12 |
110.215 |
|
H9 |
C3 |
H10 |
106.669 |
|
H11 |
C4 |
H12 |
106.669 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.