|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHFCl2 (fluorodichloromethane)
1A' CS
1910171554
InChI=1S/CHCl2F/c2-1(3)4/h1H INChIKey=UMNKXPULIDJLSU-UHFFFAOYSA-N
CID/6-311G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1764 |
0.5131 |
0.0000 |
|
-0.2422 |
0.4523 |
-0.1764 |
| H2 |
-1.0633 |
1.1287 |
0.0000 |
|
-0.5327 |
0.9950 |
-1.0633 |
| F3 |
0.9021 |
1.3000 |
0.0000 |
|
-0.6136 |
1.1461 |
0.9021 |
| Cl4 |
-0.1764 |
-0.4679 |
1.4583 |
|
1.5064 |
0.2758 |
-0.1764 |
| Cl5 |
-0.1764 |
-0.4679 |
-1.4583 |
|
-1.0648 |
-1.1008 |
-0.1764 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Cl4 |
Cl5 |
| C1 |
|
1.0796 |
1.3350 |
1.7575 |
1.7575 |
| H2 |
1.0796 |
| 1.9728 |
2.3371 |
2.3371 |
| F3 |
1.3350 |
1.9728 |
| 2.5328 |
2.5328 |
| Cl4 |
1.7575 |
2.3371 |
2.5328 |
| 2.9166 |
| Cl5 |
1.7575 |
2.3371 |
2.5328 |
2.9166 |
|
Maximum atom distance is 2.9166Å
between atoms Cl4 and Cl5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Cl4 |
109.208 |
|
F3 |
C1 |
Cl5 |
109.208 |
|
Cl4 |
C1 |
Cl5 |
112.144 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
109.121 |
|
H2 |
C1 |
Cl4 |
108.556 |
|
H2 |
C1 |
Cl5 |
108.556 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.