|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for HO2CCHNH2CH2OH (Serine)
1A C1
1910171554
InChI=1S/C3H7NO3/c4-2(1-5)3(6)7/h2,5H,1,4H2,(H,6,7)/t2-/m0/s1 INChIKey=MTCFGRXMJLQNBG-UWTATZPHSA-N
B3PW91/6-311G*
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.7768 |
-0.5438 |
-0.0013 |
|
0.7768 |
-0.5437 |
-0.0150 |
| O2 |
2.0568 |
-0.3466 |
-0.3559 |
|
2.0539 |
-0.3415 |
-0.3772 |
| O3 |
0.4013 |
-1.5553 |
0.5411 |
|
0.4056 |
-1.5625 |
0.5165 |
| C4 |
-0.0879 |
0.6760 |
-0.3095 |
|
-0.0904 |
0.6802 |
-0.2995 |
| C5 |
-1.5142 |
0.4438 |
0.1874 |
|
-1.5126 |
0.4411 |
0.2057 |
| O6 |
-2.1048 |
-0.6976 |
-0.3781 |
|
-2.1078 |
-0.6926 |
-0.3705 |
| N7 |
0.4388 |
1.9236 |
0.2257 |
|
0.4406 |
1.9204 |
0.2484 |
| H8 |
2.5548 |
-1.1409 |
-0.1198 |
|
2.5537 |
-1.1389 |
-0.1561 |
| H9 |
-0.1270 |
0.7644 |
-1.4012 |
|
-0.1384 |
0.7834 |
-1.3896 |
| H10 |
-1.5083 |
0.3927 |
1.2870 |
|
-1.4979 |
0.3749 |
1.3044 |
| H11 |
-2.1139 |
1.3081 |
-0.1016 |
|
-2.1147 |
1.3092 |
-0.0666 |
| H12 |
-1.6516 |
-1.4614 |
-0.0073 |
|
-1.6516 |
-1.4613 |
-0.0139 |
| H13 |
1.3368 |
2.1467 |
-0.1838 |
|
1.3353 |
2.1492 |
-0.1653 |
| H14 |
0.5632 |
1.8649 |
1.2299 |
|
0.5732 |
1.8480 |
1.2506 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
O3 |
C4 |
C5 |
O6 |
N7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
H14 |
| C1 |
|
1.3428 |
1.2075 |
1.5267 |
2.5019 |
2.9102 |
2.5008 |
1.8793 |
2.1185 |
2.7854 |
3.4345 |
2.5960 |
2.7543 |
2.7136 |
| O2 |
1.3428 |
| 2.2374 |
2.3765 |
3.6976 |
4.1764 |
2.8478 |
0.9667 |
2.6639 |
3.9945 |
4.4942 |
3.8880 |
2.6009 |
3.1042 |
| O3 |
1.2075 |
2.2374 |
| 2.4375 |
2.7911 |
2.8037 |
3.4933 |
2.2904 |
3.0712 |
2.8280 |
3.8650 |
2.1269 |
3.8866 |
3.4926 |
| C4 |
1.5267 |
2.3765 |
2.4375 |
|
1.5281 |
2.4412 |
1.4561 |
3.2126 |
1.0960 |
2.1556 |
2.1325 |
2.6655 |
2.0515 |
2.0512 |
| C5 |
2.5019 |
3.6976 |
2.7911 |
1.5281 |
|
1.4041 |
2.4506 |
4.3775 |
2.1333 |
1.1007 |
1.0910 |
1.9201 |
3.3415 |
2.7243 |
| O6 |
2.9102 |
4.1764 |
2.8037 |
2.4412 |
1.4041 |
| 3.7020 |
4.6877 |
2.6638 |
2.0777 |
2.0247 |
0.9624 |
4.4691 |
4.0337 |
| N7 |
2.5008 |
2.8478 |
3.4933 |
1.4561 |
2.4506 |
3.7020 |
| 3.7400 |
2.0763 |
2.6947 |
2.6462 |
3.9852 |
1.0119 |
1.0136 |
| H8 |
1.8793 |
0.9667 |
2.2904 |
3.2126 |
4.3775 |
4.6877 |
3.7400 |
| 3.5305 |
4.5650 |
5.2721 |
4.2200 |
3.5066 |
3.8500 |
| H9 |
2.1185 |
2.6639 |
3.0712 |
1.0960 |
2.1333 |
2.6638 |
2.0763 |
3.5305 |
| 3.0451 |
2.4357 |
3.0367 |
2.3528 |
2.9344 |
| H10 |
2.7854 |
3.9945 |
2.8280 |
2.1556 |
1.1007 |
2.0777 |
2.6947 |
4.5650 |
3.0451 |
| 1.7700 |
2.2657 |
3.6517 |
2.5421 |
| H11 |
3.4345 |
4.4942 |
3.8650 |
2.1325 |
1.0910 |
2.0247 |
2.6462 |
5.2721 |
2.4357 |
1.7700 |
| 2.8094 |
3.5521 |
3.0414 |
| H12 |
2.5960 |
3.8880 |
2.1269 |
2.6655 |
1.9201 |
0.9624 |
3.9852 |
4.2200 |
3.0367 |
2.2657 |
2.8094 |
| 4.6883 |
4.1834 |
| H13 |
2.7543 |
2.6009 |
3.8866 |
2.0515 |
3.3415 |
4.4691 |
1.0119 |
3.5066 |
2.3528 |
3.6517 |
3.5521 |
4.6883 |
| 1.6360 |
| H14 |
2.7136 |
3.1042 |
3.4926 |
2.0512 |
2.7243 |
4.0337 |
1.0136 |
3.8500 |
2.9344 |
2.5421 |
3.0414 |
4.1834 |
1.6360 |
|
Maximum atom distance is 5.2721Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
C5 |
109.974 |
|
C1 |
C4 |
N7 |
113.923 |
|
O2 |
C1 |
O3 |
122.552 |
|
O2 |
C1 |
C4 |
111.669 |
|
O3 |
C1 |
C4 |
125.718 |
|
C4 |
C5 |
O6 |
112.651 |
|
C5 |
C4 |
N7 |
110.379 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
O2 |
H8 |
107.810 |
|
C1 |
C4 |
H9 |
106.603 |
|
C4 |
C5 |
H10 |
109.084 |
|
C4 |
C5 |
H11 |
107.852 |
|
C4 |
N7 |
H13 |
111.171 |
|
C4 |
N7 |
H14 |
111.038 |
|
C5 |
C4 |
H9 |
107.631 |
|
C5 |
O6 |
H12 |
106.973 |
|
O6 |
C5 |
H10 |
111.516 |
|
O6 |
C5 |
H11 |
107.823 |
|
N7 |
C4 |
H9 |
108.057 |
|
H10 |
C5 |
H11 |
107.722 |
|
H13 |
N7 |
H14 |
107.744 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.