|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for ClCOClCO (Oxalyl chloride)
1AG C2H
1910171554
InChI=1S/C2Cl2O2/c3-1(5)2(4)6 INChIKey=CTSLXHKWHWQRSH-UHFFFAOYSA-N
CCD/6-311G*
Point group is C2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1674 |
0.7597 |
0.0000 |
|
0.7368 |
0.2496 |
0.0000 |
| C2 |
0.1674 |
-0.7597 |
0.0000 |
|
-0.7368 |
-0.2496 |
0.0000 |
| O3 |
-1.2660 |
1.1931 |
0.0000 |
|
1.6759 |
-0.4666 |
0.0000 |
| O4 |
1.2660 |
-1.1931 |
0.0000 |
|
-1.6759 |
0.4666 |
0.0000 |
| Cl5 |
1.2660 |
1.7592 |
0.0000 |
|
0.8510 |
1.9933 |
0.0000 |
| Cl6 |
-1.2660 |
-1.7592 |
0.0000 |
|
-0.8510 |
-1.9933 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
O4 |
Cl5 |
Cl6 |
| C1 |
|
1.5558 |
1.1811 |
2.4224 |
1.7475 |
2.7480 |
| C2 |
1.5558 |
| 2.4224 |
1.1811 |
2.7480 |
1.7475 |
| O3 |
1.1811 |
2.4224 |
| 3.4793 |
2.5946 |
2.9523 |
| O4 |
2.4224 |
1.1811 |
3.4793 |
| 2.9523 |
2.5946 |
| Cl5 |
1.7475 |
2.7480 |
2.5946 |
2.9523 |
| 4.3348 |
| Cl6 |
2.7480 |
1.7475 |
2.9523 |
2.5946 |
4.3348 |
|
Maximum atom distance is 4.3348Å
between atoms Cl5 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O4 |
123.958 |
|
C1 |
C2 |
Cl6 |
112.461 |
|
C2 |
C1 |
O3 |
123.958 |
|
C2 |
C1 |
Cl5 |
112.461 |
|
O3 |
C1 |
Cl5 |
123.581 |
|
O4 |
C2 |
Cl6 |
123.581 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.