|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COOCH3 (methyl acetate)
1A' CS
1910171554
InChI=1S/C3H6O2/c1-3(4)5-2/h1-2H3 INChIKey=KXKVLQRXCPHEJC-UHFFFAOYSA-N
B3PW91/6-311G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
1.1306 |
1.4837 |
0.0000 |
|
1.0458 |
1.5447 |
0.0000 |
| C2 |
0.0000 |
0.4924 |
0.0000 |
|
0.4667 |
0.1570 |
0.0000 |
| O3 |
-1.1726 |
0.7606 |
0.0000 |
|
1.0948 |
-0.8689 |
0.0000 |
| O4 |
0.4720 |
-0.7704 |
0.0000 |
|
-0.8807 |
0.2017 |
0.0000 |
| C5 |
-0.5241 |
-1.7949 |
0.0000 |
|
-1.5340 |
-1.0691 |
0.0000 |
| H6 |
0.7292 |
2.4952 |
0.0000 |
|
2.1324 |
1.4868 |
0.0000 |
| H7 |
1.7619 |
1.3351 |
0.8793 |
|
0.7036 |
2.0957 |
0.8793 |
| H8 |
1.7619 |
1.3351 |
-0.8793 |
|
0.7036 |
2.0957 |
-0.8793 |
| H9 |
0.0228 |
-2.7356 |
0.0000 |
|
-2.6001 |
-0.8507 |
0.0000 |
| H10 |
-1.1547 |
-1.7195 |
0.8877 |
|
-1.2615 |
-1.6427 |
0.8877 |
| H11 |
-1.1547 |
-1.7195 |
-0.8877 |
|
-1.2615 |
-1.6427 |
-0.8877 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
O3 |
O4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5036 |
2.4140 |
2.3484 |
3.6725 |
1.0882 |
1.0927 |
1.0927 |
4.3623 |
4.0337 |
4.0337 |
| C2 |
1.5036 |
|
1.2029 |
1.3481 |
2.3465 |
2.1314 |
2.1419 |
2.1419 |
3.2281 |
2.6484 |
2.6484 |
| O3 |
2.4140 |
1.2029 |
| 2.2470 |
2.6365 |
2.5740 |
3.1169 |
3.1169 |
3.6950 |
2.6343 |
2.6343 |
| O4 |
2.3484 |
1.3481 |
2.2470 |
|
1.4289 |
3.2757 |
2.6212 |
2.6212 |
2.0159 |
2.0820 |
2.0820 |
| C5 |
3.6725 |
2.3465 |
2.6365 |
1.4289 |
| 4.4694 |
3.9744 |
3.9744 |
1.0882 |
1.0915 |
1.0915 |
| H6 |
1.0882 |
2.1314 |
2.5740 |
3.2757 |
4.4694 |
| 1.7848 |
1.7848 |
5.2783 |
4.7011 |
4.7011 |
| H7 |
1.0927 |
2.1419 |
3.1169 |
2.6212 |
3.9744 |
1.7848 |
| 1.7587 |
4.5132 |
4.2234 |
4.5782 |
| H8 |
1.0927 |
2.1419 |
3.1169 |
2.6212 |
3.9744 |
1.7848 |
1.7587 |
| 4.5132 |
4.5782 |
4.2234 |
| H9 |
4.3623 |
3.2281 |
3.6950 |
2.0159 |
1.0882 |
5.2783 |
4.5132 |
4.5132 |
| 1.7908 |
1.7908 |
| H10 |
4.0337 |
2.6484 |
2.6343 |
2.0820 |
1.0915 |
4.7011 |
4.2234 |
4.5782 |
1.7908 |
| 1.7754 |
| H11 |
4.0337 |
2.6484 |
2.6343 |
2.0820 |
1.0915 |
4.7011 |
4.5782 |
4.2234 |
1.7908 |
1.7754 |
|
Maximum atom distance is 5.2783Å
between atoms H6 and H9.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
O3 |
125.871 |
|
C1 |
C2 |
O4 |
110.752 |
|
C2 |
O4 |
C5 |
115.310 |
|
O3 |
C2 |
O4 |
123.377 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
H6 |
109.602 |
|
C2 |
C1 |
H7 |
110.169 |
|
C2 |
C1 |
H8 |
110.169 |
|
O4 |
C5 |
H9 |
105.631 |
|
O4 |
C5 |
H10 |
110.686 |
|
O4 |
C5 |
H11 |
110.686 |
|
H6 |
C1 |
H7 |
109.848 |
|
H6 |
C1 |
H8 |
109.848 |
|
H7 |
C1 |
H8 |
107.173 |
|
H9 |
C5 |
H10 |
110.490 |
|
H9 |
C5 |
H11 |
110.490 |
|
H10 |
C5 |
H11 |
108.842 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.