|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C2ClF3 (Ethene, chlorotrifluoro-)
1A' CS
1910171554
InChI=1S/C2ClF3/c3-1(4)2(5)6 INChIKey=UUAGAQFQZIEFAH-UHFFFAOYSA-N
CCSD/6-311G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.6849 |
-0.6661 |
0.0000 |
|
0.9361 |
0.1911 |
0.0000 |
| C2 |
0.0000 |
0.4730 |
0.0000 |
|
-0.2553 |
-0.3982 |
0.0000 |
| F3 |
-1.9976 |
-0.7184 |
0.0000 |
|
2.0694 |
-0.4734 |
0.0000 |
| F4 |
-0.1300 |
-1.8557 |
0.0000 |
|
1.1110 |
1.4920 |
0.0000 |
| F5 |
-0.6391 |
1.6401 |
0.0000 |
|
-0.3472 |
-1.7257 |
0.0000 |
| Cl6 |
1.7065 |
0.5626 |
0.0000 |
|
-1.7403 |
0.4474 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
F3 |
F4 |
F5 |
Cl6 |
| C1 |
|
1.3292 |
1.3137 |
1.3126 |
2.3067 |
2.6886 |
| C2 |
1.3292 |
| 2.3259 |
2.3323 |
1.3307 |
1.7089 |
| F3 |
1.3137 |
2.3259 |
| 2.1866 |
2.7218 |
3.9194 |
| F4 |
1.3126 |
2.3323 |
2.1866 |
| 3.5327 |
3.0366 |
| F5 |
2.3067 |
1.3307 |
2.7218 |
3.5327 |
| 2.5813 |
| Cl6 |
2.6886 |
1.7089 |
3.9194 |
3.0366 |
2.5813 |
|
Maximum atom distance is 3.9194Å
between atoms F3 and Cl6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
F5 |
120.278 |
|
C1 |
C2 |
Cl6 |
124.026 |
|
C2 |
C1 |
F3 |
123.299 |
|
C2 |
C1 |
F4 |
123.974 |
|
F3 |
C1 |
F4 |
112.727 |
|
F5 |
C2 |
Cl6 |
115.697 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.