|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3SOCH3 (Dimethyl sulfoxide)
1A' CS
1910171554
InChI=1S/C2H6OS/c1-4(2)3/h1-2H3 INChIKey=IAZDPXIOMUYVGZ-UHFFFAOYSA-N
HF/6-311G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| S1 |
0.2569 |
0.4166 |
0.0000 |
|
0.0000 |
0.2072 |
0.4434 |
| O2 |
-1.0867 |
1.0443 |
0.0000 |
|
0.0000 |
1.4695 |
-0.3348 |
| C3 |
0.2569 |
-0.7622 |
1.3560 |
|
1.3560 |
-0.7780 |
-0.2038 |
| C4 |
0.2569 |
-0.7622 |
-1.3560 |
|
-1.3560 |
-0.7780 |
-0.2038 |
| H5 |
1.1586 |
-1.3606 |
1.3373 |
|
1.3373 |
-1.7733 |
0.2213 |
| H6 |
1.1586 |
-1.3606 |
-1.3373 |
|
-1.3373 |
-1.7733 |
0.2213 |
| H7 |
0.2172 |
-0.1929 |
2.2738 |
|
2.2738 |
-0.2805 |
0.0756 |
| H8 |
0.2172 |
-0.1929 |
-2.2738 |
|
-2.2738 |
-0.2805 |
0.0756 |
| H9 |
-0.6251 |
-1.3839 |
1.2824 |
|
1.2824 |
-0.8135 |
-1.2823 |
| H10 |
-0.6251 |
-1.3839 |
-1.2824 |
|
-1.2824 |
-0.8135 |
-1.2823 |
Atom - Atom Distances (Å)
| |
S1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| S1 |
| 1.4829 |
1.7967 |
1.7967 |
2.4000 |
2.4000 |
2.3544 |
2.3544 |
2.3800 |
2.3800 |
| O2 |
1.4829 |
| 2.6282 |
2.6282 |
3.5515 |
3.5515 |
2.8985 |
2.8985 |
2.7846 |
2.7846 |
| C3 |
1.7967 |
2.6282 |
| 2.7120 |
1.0824 |
2.9026 |
1.0807 |
3.6744 |
1.0816 |
2.8505 |
| C4 |
1.7967 |
2.6282 |
2.7120 |
| 2.9026 |
1.0824 |
3.6744 |
1.0807 |
2.8505 |
1.0816 |
| H5 |
2.4000 |
3.5515 |
1.0824 |
2.9026 |
| 2.6746 |
1.7682 |
3.9102 |
1.7847 |
3.1694 |
| H6 |
2.4000 |
3.5515 |
2.9026 |
1.0824 |
2.6746 |
| 3.9102 |
1.7682 |
3.1694 |
1.7847 |
| H7 |
2.3544 |
2.8985 |
1.0807 |
3.6744 |
1.7682 |
3.9102 |
| 4.5476 |
1.7638 |
3.8437 |
| H8 |
2.3544 |
2.8985 |
3.6744 |
1.0807 |
3.9102 |
1.7682 |
4.5476 |
| 3.8437 |
1.7638 |
| H9 |
2.3800 |
2.7846 |
1.0816 |
2.8505 |
1.7847 |
3.1694 |
1.7638 |
3.8437 |
| 2.5648 |
| H10 |
2.3800 |
2.7846 |
2.8505 |
1.0816 |
3.1694 |
1.7847 |
3.8437 |
1.7638 |
2.5648 |
|
Maximum atom distance is 4.5476Å
between atoms H7 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
S1 |
C3 |
106.124 |
|
O2 |
S1 |
C4 |
106.124 |
|
C3 |
S1 |
C4 |
97.998 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S1 |
C3 |
H5 |
110.468 |
|
S1 |
C3 |
H7 |
107.181 |
|
S1 |
C3 |
H9 |
109.014 |
|
S1 |
C4 |
H6 |
110.468 |
|
S1 |
C4 |
H8 |
107.181 |
|
S1 |
C4 |
H10 |
109.014 |
|
H5 |
C3 |
H7 |
109.658 |
|
H5 |
C3 |
H9 |
111.119 |
|
H6 |
C4 |
H8 |
109.658 |
|
H6 |
C4 |
H10 |
111.119 |
|
H7 |
C3 |
H9 |
109.310 |
|
H8 |
C4 |
H10 |
109.310 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.