|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for B2Cl4 (Diboron tetrachloride)
1A1 D2
1910171554
InChI=1S/B2Cl4/c3-1(4)2(5)6 INChIKey=LCWVIHDXYOFGEG-UHFFFAOYSA-N
CISD/6-311G*
Point group is D2d
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| B1 |
0.0000 |
0.0000 |
0.8476 |
|
0.8476 |
0.0000 |
0.0000 |
| B2 |
0.0000 |
0.0000 |
-0.8476 |
|
-0.8476 |
0.0000 |
0.0000 |
| Cl3 |
0.0000 |
1.5085 |
1.7233 |
|
1.7233 |
1.5085 |
0.0000 |
| Cl4 |
0.0000 |
-1.5085 |
1.7233 |
|
1.7233 |
-1.5085 |
0.0000 |
| Cl5 |
1.5085 |
0.0000 |
-1.7233 |
|
-1.7233 |
0.0000 |
1.5085 |
| Cl6 |
-1.5085 |
0.0000 |
-1.7233 |
|
-1.7233 |
0.0000 |
-1.5085 |
Atom - Atom Distances (Å)
| |
B1 |
B2 |
Cl3 |
Cl4 |
Cl5 |
Cl6 |
| B1 |
| 1.6952 |
1.7442 |
1.7442 |
2.9808 |
2.9808 |
| B2 |
1.6952 |
| 2.9808 |
2.9808 |
1.7442 |
1.7442 |
| Cl3 |
1.7442 |
2.9808 |
| 3.0170 |
4.0534 |
4.0534 |
| Cl4 |
1.7442 |
2.9808 |
3.0170 |
| 4.0534 |
4.0534 |
| Cl5 |
2.9808 |
1.7442 |
4.0534 |
4.0534 |
| 3.0170 |
| Cl6 |
2.9808 |
1.7442 |
4.0534 |
4.0534 |
3.0170 |
|
Maximum atom distance is 4.0534Å
between atoms Cl3 and Cl5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
B1 |
B2 |
Cl5 |
120.135 |
|
B1 |
B2 |
Cl6 |
120.135 |
|
B2 |
B1 |
Cl3 |
120.135 |
|
B2 |
B1 |
Cl4 |
120.135 |
|
Cl3 |
B1 |
Cl4 |
119.731 |
|
Cl5 |
B2 |
Cl6 |
119.731 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.