|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHSHCH3 (2-Propanethiol)
1A' CS
1910171554
InChI=1S/C3H8S/c1-3(2)4/h3-4H,1-2H3 INChIKey=KJRCEJOSASVSRA-UHFFFAOYSA-N
QCISD/6-311G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.5643 |
0.0000 |
|
-0.0000 |
-0.0000 |
0.5643 |
| S2 |
-0.9878 |
-0.9781 |
0.0000 |
|
-0.6813 |
0.7152 |
-0.9781 |
| H3 |
-0.7653 |
1.3520 |
0.0000 |
|
-0.5279 |
0.5542 |
1.3520 |
| H4 |
0.0728 |
-1.8180 |
0.0000 |
|
0.0502 |
-0.0527 |
-1.8180 |
| C5 |
0.8434 |
0.6963 |
1.2688 |
|
1.5004 |
0.2645 |
0.6963 |
| C6 |
0.8434 |
0.6963 |
-1.2688 |
|
-0.3370 |
-1.4858 |
0.6963 |
| H7 |
1.5963 |
-0.1009 |
1.3177 |
|
2.0551 |
-0.2469 |
-0.1009 |
| H8 |
1.5963 |
-0.1009 |
-1.3177 |
|
0.1469 |
-2.0647 |
-0.1009 |
| H9 |
1.3707 |
1.6592 |
1.2803 |
|
1.8725 |
-0.1094 |
1.6592 |
| H10 |
0.2213 |
0.6286 |
2.1666 |
|
1.7214 |
1.3341 |
0.6286 |
| H11 |
0.2213 |
0.6286 |
-2.1666 |
|
-1.4161 |
-1.6546 |
0.6286 |
| H12 |
1.3707 |
1.6592 |
-1.2803 |
|
0.0184 |
-1.8756 |
1.6592 |
Atom - Atom Distances (Å)
| |
C1 |
S2 |
H3 |
H4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
| 1.8316 |
1.0983 |
2.3835 |
1.5292 |
1.5292 |
2.1742 |
2.1742 |
2.1718 |
2.1788 |
2.1788 |
2.1718 |
| S2 |
1.8316 |
| 2.3407 |
1.3529 |
2.7869 |
2.7869 |
3.0304 |
3.0304 |
3.7626 |
2.9560 |
2.9560 |
3.7626 |
| H3 |
1.0983 |
2.3407 |
| 3.2790 |
2.1512 |
2.1512 |
3.0700 |
3.0700 |
2.5093 |
2.4882 |
2.4882 |
2.5093 |
| H4 |
2.3835 |
1.3529 |
3.2790 |
| 2.9199 |
2.9199 |
2.6469 |
2.6469 |
3.9262 |
3.2715 |
3.2715 |
3.9262 |
| C5 |
1.5292 |
2.7869 |
2.1512 |
2.9199 |
| 2.5376 |
1.0977 |
2.8094 |
1.0979 |
1.0944 |
3.4920 |
2.7755 |
| C6 |
1.5292 |
2.7869 |
2.1512 |
2.9199 |
2.5376 |
| 2.8094 |
1.0977 |
2.7755 |
3.4920 |
1.0944 |
1.0979 |
| H7 |
2.1742 |
3.0304 |
3.0700 |
2.6469 |
1.0977 |
2.8094 |
| 2.6355 |
1.7749 |
1.7730 |
3.8162 |
3.1462 |
| H8 |
2.1742 |
3.0304 |
3.0700 |
2.6469 |
2.8094 |
1.0977 |
2.6355 |
| 3.1462 |
3.8162 |
1.7730 |
1.7749 |
| H9 |
2.1718 |
3.7626 |
2.5093 |
3.9262 |
1.0979 |
2.7755 |
1.7749 |
3.1462 |
| 1.7801 |
3.7769 |
2.5607 |
| H10 |
2.1788 |
2.9560 |
2.4882 |
3.2715 |
1.0944 |
3.4920 |
1.7730 |
3.8162 |
1.7801 |
| 4.3332 |
3.7769 |
| H11 |
2.1788 |
2.9560 |
2.4882 |
3.2715 |
3.4920 |
1.0944 |
3.8162 |
1.7730 |
3.7769 |
4.3332 |
| 1.7801 |
| H12 |
2.1718 |
3.7626 |
2.5093 |
3.9262 |
2.7755 |
1.0979 |
3.1462 |
1.7749 |
2.5607 |
3.7769 |
1.7801 |
|
Maximum atom distance is 4.3332Å
between atoms H10 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
S2 |
C1 |
C5 |
111.722 |
|
S2 |
C1 |
C6 |
111.722 |
|
C5 |
C1 |
C6 |
112.135 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
S2 |
H4 |
95.743 |
|
C1 |
C5 |
H7 |
110.645 |
|
C1 |
C5 |
H9 |
110.445 |
|
C1 |
C5 |
H10 |
111.215 |
|
C1 |
C6 |
H8 |
110.645 |
|
C1 |
C6 |
H11 |
111.215 |
|
C1 |
C6 |
H12 |
110.445 |
|
S2 |
C1 |
H3 |
103.188 |
|
H3 |
C1 |
C5 |
108.809 |
|
H3 |
C1 |
C6 |
108.809 |
|
H7 |
C5 |
H9 |
107.881 |
|
H7 |
C5 |
H10 |
107.963 |
|
H8 |
C6 |
H11 |
107.963 |
|
H8 |
C6 |
H12 |
107.881 |
|
H9 |
C5 |
H10 |
108.583 |
|
H11 |
C6 |
H12 |
108.583 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.