|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for NH(CH3)CONH(CH3) (Urea, N,N'-dimethyl-)
1A C2
1910171554
InChI=1S/C3H8N2O/c1-4-3(6)5-2/h1-2H3,(H2,4,5,6) INChIKey=MGJKQDOBUOMPEZ-UHFFFAOYSA-N
HF/6-311G*
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1000 |
|
0.0997 |
-0.0077 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.2952 |
|
1.2913 |
-0.0998 |
0.0000 |
| N3 |
0.0000 |
1.1489 |
-0.6492 |
|
-0.6472 |
0.0500 |
1.1489 |
| N4 |
0.0000 |
-1.1489 |
-0.6492 |
|
-0.6472 |
0.0500 |
-1.1489 |
| C5 |
-0.2184 |
2.4187 |
0.0134 |
|
-0.0035 |
-0.2188 |
2.4187 |
| C6 |
0.2184 |
-2.4187 |
0.0134 |
|
0.0302 |
0.2167 |
-2.4187 |
| H7 |
-0.3840 |
1.0680 |
-1.5611 |
|
-1.5860 |
-0.2625 |
1.0680 |
| H8 |
0.3840 |
-1.0680 |
-1.5611 |
|
-1.5268 |
0.5032 |
-1.0680 |
| H9 |
-0.0083 |
3.2157 |
-0.6881 |
|
-0.6867 |
0.0448 |
3.2157 |
| H10 |
0.0083 |
-3.2157 |
-0.6881 |
|
-0.6854 |
0.0613 |
-3.2157 |
| H11 |
0.4564 |
2.5072 |
0.8499 |
|
0.8826 |
0.3895 |
2.5072 |
| H12 |
-0.4564 |
-2.5072 |
0.8499 |
|
0.8122 |
-0.5205 |
-2.5072 |
| H13 |
-1.2336 |
2.5298 |
0.3822 |
|
0.2860 |
-1.2594 |
2.5298 |
| H14 |
1.2336 |
-2.5298 |
0.3822 |
|
0.4761 |
1.2005 |
-2.5298 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
N3 |
N4 |
C5 |
C6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
H14 |
| C1 |
|
1.1952 |
1.3716 |
1.3716 |
2.4301 |
2.4301 |
2.0118 |
2.0118 |
3.3109 |
3.3109 |
2.6564 |
2.6564 |
2.8286 |
2.8286 |
| O2 |
1.1952 |
| 2.2584 |
2.2584 |
2.7461 |
2.7461 |
3.0735 |
3.0735 |
3.7781 |
3.7781 |
2.5870 |
2.5870 |
2.9589 |
2.9589 |
| N3 |
1.3716 |
2.2584 |
| 2.2978 |
1.4489 |
3.6352 |
0.9928 |
2.4277 |
2.0672 |
4.3648 |
2.0738 |
3.9777 |
2.1195 |
4.0147 |
| N4 |
1.3716 |
2.2584 |
2.2978 |
| 3.6352 |
1.4489 |
2.4277 |
0.9928 |
4.3648 |
2.0672 |
3.9777 |
2.0738 |
4.0147 |
2.1195 |
| C5 |
2.4301 |
2.7461 |
1.4489 |
3.6352 |
| 4.8572 |
2.0811 |
3.8729 |
1.0823 |
5.6825 |
1.0784 |
5.0021 |
1.0859 |
5.1703 |
| C6 |
2.4301 |
2.7461 |
3.6352 |
1.4489 |
4.8572 |
| 3.8729 |
2.0811 |
5.6825 |
1.0823 |
5.0021 |
1.0784 |
5.1703 |
1.0859 |
| H7 |
2.0118 |
3.0735 |
0.9928 |
2.4277 |
2.0811 |
3.8729 |
| 2.2698 |
2.3486 |
4.3893 |
2.9310 |
4.3128 |
2.5759 |
4.3974 |
| H8 |
2.0118 |
3.0735 |
2.4277 |
0.9928 |
3.8729 |
2.0811 |
2.2698 |
| 4.3893 |
2.3486 |
4.3128 |
2.9310 |
4.3974 |
2.5759 |
| H9 |
3.3109 |
3.7781 |
2.0672 |
4.3648 |
1.0823 |
5.6825 |
2.3486 |
4.3893 |
| 6.4315 |
1.7560 |
5.9429 |
1.7656 |
5.9748 |
| H10 |
3.3109 |
3.7781 |
4.3648 |
2.0672 |
5.6825 |
1.0823 |
4.3893 |
2.3486 |
6.4315 |
| 5.9429 |
1.7560 |
5.9748 |
1.7656 |
| H11 |
2.6564 |
2.5870 |
2.0738 |
3.9777 |
1.0784 |
5.0021 |
2.9310 |
4.3128 |
1.7560 |
5.9429 |
| 5.0967 |
1.7537 |
5.1180 |
| H12 |
2.6564 |
2.5870 |
3.9777 |
2.0738 |
5.0021 |
1.0784 |
4.3128 |
2.9310 |
5.9429 |
1.7560 |
5.0967 |
| 5.1180 |
1.7537 |
| H13 |
2.8286 |
2.9589 |
2.1195 |
4.0147 |
1.0859 |
5.1703 |
2.5759 |
4.3974 |
1.7656 |
5.9748 |
1.7537 |
5.1180 |
| 5.6291 |
| H14 |
2.8286 |
2.9589 |
4.0147 |
2.1195 |
5.1703 |
1.0859 |
4.3974 |
2.5759 |
5.9748 |
1.7656 |
5.1180 |
1.7537 |
5.6291 |
|
Maximum atom distance is 6.4315Å
between atoms H9 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N3 |
C5 |
118.972 |
|
C1 |
N4 |
C6 |
118.972 |
|
O2 |
C1 |
N3 |
123.107 |
|
O2 |
C1 |
N4 |
123.107 |
|
N3 |
C1 |
N4 |
113.786 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
N3 |
H7 |
115.686 |
|
C1 |
N4 |
H8 |
115.686 |
|
N3 |
C5 |
H9 |
108.647 |
|
N3 |
C5 |
H11 |
109.408 |
|
N3 |
C5 |
H13 |
112.697 |
|
N4 |
C6 |
H10 |
108.647 |
|
N4 |
C6 |
H12 |
109.408 |
|
N4 |
C6 |
H14 |
112.697 |
|
C5 |
N3 |
H7 |
115.670 |
|
C6 |
N4 |
H8 |
115.670 |
|
H9 |
C5 |
H11 |
108.720 |
|
H9 |
C5 |
H13 |
109.046 |
|
H10 |
C6 |
H12 |
108.720 |
|
H10 |
C6 |
H14 |
109.046 |
|
H11 |
C5 |
H13 |
108.251 |
|
H12 |
C6 |
H14 |
108.251 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.