|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
B2PLYP=FULL/3-21G*
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1929 |
|
0.1929 |
-0.0001 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4321 |
|
1.4321 |
-0.0008 |
0.0000 |
| C3 |
0.0000 |
1.2839 |
-0.6320 |
|
-0.6320 |
0.0004 |
1.2839 |
| C4 |
0.0000 |
-1.2839 |
-0.6320 |
|
-0.6320 |
0.0004 |
-1.2839 |
| H5 |
0.0004 |
2.1439 |
0.0378 |
|
0.0378 |
0.0004 |
2.1439 |
| H6 |
-0.0004 |
-2.1439 |
0.0378 |
|
0.0378 |
-0.0005 |
-2.1439 |
| H7 |
0.8842 |
1.3162 |
-1.2768 |
|
-1.2763 |
0.8849 |
1.3162 |
| H8 |
-0.8848 |
1.3166 |
-1.2759 |
|
-1.2764 |
-0.8841 |
1.3166 |
| H9 |
-0.8842 |
-1.3162 |
-1.2768 |
|
-1.2773 |
-0.8835 |
-1.3162 |
| H10 |
0.8848 |
-1.3166 |
-1.2759 |
|
-1.2754 |
0.8856 |
-1.3166 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2392 |
1.5260 |
1.5260 |
2.1495 |
2.1495 |
2.1620 |
2.1619 |
2.1620 |
2.1619 |
| O2 |
1.2392 |
| 2.4308 |
2.4308 |
2.5574 |
2.5574 |
3.1388 |
3.1384 |
3.1388 |
3.1384 |
| C3 |
1.5260 |
2.4308 |
| 2.5678 |
1.0901 |
3.4926 |
1.0948 |
1.0948 |
2.8210 |
2.8214 |
| C4 |
1.5260 |
2.4308 |
2.5678 |
| 3.4926 |
1.0901 |
2.8210 |
2.8214 |
1.0948 |
1.0948 |
| H5 |
2.1495 |
2.5574 |
1.0901 |
3.4926 |
| 4.2878 |
1.7872 |
1.7871 |
3.8057 |
3.8057 |
| H6 |
2.1495 |
2.5574 |
3.4926 |
1.0901 |
4.2878 |
| 3.8057 |
3.8057 |
1.7872 |
1.7871 |
| H7 |
2.1620 |
3.1388 |
1.0948 |
2.8210 |
1.7872 |
3.8057 |
| 1.7690 |
3.1713 |
2.6329 |
| H8 |
2.1619 |
3.1384 |
1.0948 |
2.8214 |
1.7871 |
3.8057 |
1.7690 |
| 2.6329 |
3.1727 |
| H9 |
2.1620 |
3.1388 |
2.8210 |
1.0948 |
3.8057 |
1.7872 |
3.1713 |
2.6329 |
| 1.7690 |
| H10 |
2.1619 |
3.1384 |
2.8214 |
1.0948 |
3.8057 |
1.7871 |
2.6329 |
3.1727 |
1.7690 |
|
Maximum atom distance is 4.2878Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
122.720 |
|
O2 |
C1 |
C4 |
122.720 |
|
C3 |
C1 |
C4 |
114.561 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.368 |
|
C1 |
C3 |
H7 |
110.073 |
|
C1 |
C3 |
H8 |
110.064 |
|
C1 |
C4 |
H6 |
109.368 |
|
C1 |
C4 |
H9 |
110.073 |
|
C1 |
C4 |
H10 |
110.064 |
|
H5 |
C3 |
H7 |
109.770 |
|
H5 |
C3 |
H8 |
109.761 |
|
H6 |
C4 |
H9 |
109.770 |
|
H6 |
C4 |
H10 |
109.761 |
|
H7 |
C3 |
H8 |
107.786 |
|
H9 |
C4 |
H10 |
107.786 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.