|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH2COOH (Propanoic Acid)
1A' CS
1910171554
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) INChIKey=XBDQKXXYIPTUBI-UHFFFAOYSA-N
CID/3-21G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.5612 |
0.0000 |
|
0.5515 |
-0.1039 |
0.0000 |
| C2 |
-0.6112 |
-0.8204 |
0.0000 |
|
-0.9194 |
-0.4487 |
0.0000 |
| C3 |
0.4775 |
-1.9064 |
0.0000 |
|
-1.7850 |
0.8223 |
0.0000 |
| O4 |
-0.9824 |
1.5271 |
0.0000 |
|
1.3187 |
-1.2482 |
0.0000 |
| O5 |
1.1864 |
0.8339 |
0.0000 |
|
1.0392 |
1.0115 |
0.0000 |
| H6 |
-1.2568 |
-0.8994 |
0.8773 |
|
-1.1166 |
-1.0685 |
0.8773 |
| H7 |
-1.2568 |
-0.8994 |
-0.8773 |
|
-1.1166 |
-1.0685 |
-0.8773 |
| H8 |
0.0253 |
-2.8987 |
0.0000 |
|
-2.8439 |
0.5617 |
0.0000 |
| H9 |
1.1115 |
-1.8073 |
-0.8811 |
|
-1.5702 |
1.4269 |
-0.8811 |
| H10 |
1.1115 |
-1.8073 |
0.8811 |
|
-1.5702 |
1.4269 |
0.8811 |
| H11 |
-0.5652 |
2.4177 |
0.0000 |
|
2.2712 |
-1.0032 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
O5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5107 |
2.5134 |
1.3777 |
1.2174 |
2.1171 |
2.1171 |
3.4600 |
2.7607 |
2.7607 |
1.9407 |
| C2 |
1.5107 |
|
1.5378 |
2.3766 |
2.4430 |
1.0921 |
1.0921 |
2.1736 |
2.1721 |
2.1721 |
3.2384 |
| C3 |
2.5134 |
1.5378 |
| 3.7309 |
2.8306 |
2.1889 |
2.1889 |
1.0905 |
1.0900 |
1.0900 |
4.4481 |
| O4 |
1.3777 |
2.3766 |
3.7309 |
| 2.2769 |
2.5947 |
2.5947 |
4.5390 |
4.0347 |
4.0347 |
0.9835 |
| O5 |
1.2174 |
2.4430 |
2.8306 |
2.2769 |
| 3.1214 |
3.1214 |
3.9091 |
2.7854 |
2.7854 |
2.3615 |
| H6 |
2.1171 |
1.0921 |
2.1889 |
2.5947 |
3.1214 |
| 1.7546 |
2.5319 |
3.0862 |
2.5363 |
3.5002 |
| H7 |
2.1171 |
1.0921 |
2.1889 |
2.5947 |
3.1214 |
1.7546 |
| 2.5319 |
2.5363 |
3.0862 |
3.5002 |
| H8 |
3.4600 |
2.1736 |
1.0905 |
4.5390 |
3.9091 |
2.5319 |
2.5319 |
| 1.7740 |
1.7740 |
5.3492 |
| H9 |
2.7607 |
2.1721 |
1.0900 |
4.0347 |
2.7854 |
3.0862 |
2.5363 |
1.7740 |
| 1.7622 |
4.6302 |
| H10 |
2.7607 |
2.1721 |
1.0900 |
4.0347 |
2.7854 |
2.5363 |
3.0862 |
1.7740 |
1.7622 |
| 4.6302 |
| H11 |
1.9407 |
3.2384 |
4.4481 |
0.9835 |
2.3615 |
3.5002 |
3.5002 |
5.3492 |
4.6302 |
4.6302 |
|
Maximum atom distance is 5.3492Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
111.065 |
|
C2 |
C1 |
O4 |
110.651 |
|
C2 |
C1 |
O5 |
126.812 |
|
O4 |
C1 |
O5 |
122.538 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
107.778 |
|
C1 |
C2 |
H7 |
107.778 |
|
C1 |
O4 |
H11 |
109.421 |
|
C2 |
C3 |
H8 |
110.432 |
|
C2 |
C3 |
H9 |
110.339 |
|
C2 |
C3 |
H10 |
110.339 |
|
C3 |
C2 |
H6 |
111.556 |
|
C3 |
C2 |
H7 |
111.556 |
|
H6 |
C2 |
H7 |
106.896 |
|
H8 |
C3 |
H9 |
108.899 |
|
H8 |
C3 |
H10 |
108.899 |
|
H9 |
C3 |
H10 |
107.873 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.