|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for NH2CH2CH2COOH (β–alanine)
1A C1
1910171554
InChI=1S/C3H7NO2/c4-2-1-3(5)6/h1-2,4H2,(H,5,6) INChIKey=UCMIRNVEIXFBKS-UHFFFAOYSA-N
MP2/3-21G*
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
1.9047 |
0.5687 |
0.1448 |
|
-1.9065 |
0.5613 |
0.1492 |
| C2 |
1.3392 |
-0.7292 |
-0.3929 |
|
-1.3374 |
-0.7354 |
-0.3876 |
| C3 |
0.0008 |
-1.0243 |
0.3228 |
|
0.0042 |
-1.0236 |
0.3249 |
| C4 |
-1.0852 |
0.0474 |
0.0295 |
|
1.0851 |
0.0519 |
0.0263 |
| O5 |
-0.6093 |
1.3315 |
-0.0423 |
|
0.6037 |
1.3338 |
-0.0467 |
| O6 |
-2.2836 |
-0.2350 |
-0.1040 |
|
2.2842 |
-0.2260 |
-0.1102 |
| H7 |
2.6524 |
0.9345 |
-0.4511 |
|
-2.6574 |
0.9229 |
-0.4453 |
| H8 |
2.2565 |
0.4443 |
1.0994 |
|
-2.2551 |
0.4374 |
1.1051 |
| H9 |
2.0333 |
-1.5705 |
-0.2722 |
|
-2.0277 |
-1.5793 |
-0.2632 |
| H10 |
1.1576 |
-0.5796 |
-1.4613 |
|
-1.1595 |
-0.5872 |
-1.4568 |
| H11 |
-0.4060 |
-1.9858 |
0.0004 |
|
0.4140 |
-1.9841 |
0.0031 |
| H12 |
0.1704 |
-1.0716 |
1.4072 |
|
-0.1620 |
-1.0695 |
1.4098 |
| H13 |
0.4169 |
1.3122 |
0.0778 |
|
-0.4220 |
1.3106 |
0.0764 |
Atom - Atom Distances (Å)
| |
N1 |
C2 |
C3 |
C4 |
O5 |
O6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
H13 |
| N1 |
|
1.5144 |
2.4887 |
3.0372 |
2.6338 |
4.2719 |
1.0237 |
1.0250 |
2.1833 |
2.1110 |
3.4476 |
2.7003 |
1.6645 |
| C2 |
1.5144 |
|
1.5462 |
2.5806 |
2.8576 |
3.6677 |
2.1203 |
2.1085 |
1.0974 |
1.0939 |
2.1862 |
2.1734 |
2.2890 |
| C3 |
2.4887 |
1.5462 |
|
1.5537 |
2.4607 |
2.4543 |
3.3862 |
2.8014 |
2.1871 |
2.1723 |
1.0927 |
1.0985 |
2.3858 |
| C4 |
3.0372 |
2.5806 |
1.5537 |
|
1.3713 |
1.2384 |
3.8713 |
3.5311 |
3.5262 |
2.7652 |
2.1439 |
2.1741 |
1.9643 |
| O5 |
2.6338 |
2.8576 |
2.4607 |
1.3713 |
| 2.2937 |
3.3110 |
3.2098 |
3.9316 |
2.9644 |
3.3238 |
2.9127 |
1.0334 |
| O6 |
4.2719 |
3.6677 |
2.4543 |
1.2384 |
2.2937 |
| 5.0844 |
4.7457 |
4.5219 |
3.7152 |
2.5694 |
3.0010 |
3.1176 |
| H7 |
1.0237 |
2.1203 |
3.3862 |
3.8713 |
3.3110 |
5.0844 |
| 1.6737 |
2.5866 |
2.3552 |
4.2527 |
3.6929 |
2.3280 |
| H8 |
1.0250 |
2.1085 |
2.8014 |
3.5311 |
3.2098 |
4.7457 |
1.6737 |
| 2.4476 |
2.9687 |
3.7685 |
2.5969 |
2.2761 |
| H9 |
2.1833 |
1.0974 |
2.1871 |
3.5262 |
3.9316 |
4.5219 |
2.5866 |
2.4476 |
| 1.7784 |
2.4894 |
2.5572 |
3.3234 |
| H10 |
2.1110 |
1.0939 |
2.1723 |
2.7652 |
2.9644 |
3.7152 |
2.3552 |
2.9687 |
1.7784 |
| 2.5610 |
3.0732 |
2.5488 |
| H11 |
3.4476 |
2.1862 |
1.0927 |
2.1439 |
3.3238 |
2.5694 |
4.2527 |
3.7685 |
2.4894 |
2.5610 |
| 1.7740 |
3.4000 |
| H12 |
2.7003 |
2.1734 |
1.0985 |
2.1741 |
2.9127 |
3.0010 |
3.6929 |
2.5969 |
2.5572 |
3.0732 |
1.7740 |
| 2.7405 |
| H13 |
1.6645 |
2.2890 |
2.3858 |
1.9643 |
1.0334 |
3.1176 |
2.3280 |
2.2761 |
3.3234 |
2.5488 |
3.4000 |
2.7405 |
|
Maximum atom distance is 5.0844Å
between atoms O6 and H7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
C2 |
C3 |
108.808 |
|
C2 |
C3 |
C4 |
112.706 |
|
C3 |
C4 |
O5 |
114.403 |
|
C3 |
C4 |
O6 |
122.646 |
|
O5 |
C4 |
O6 |
122.938 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
C2 |
H9 |
112.448 |
|
N1 |
C2 |
H10 |
106.951 |
|
C2 |
N1 |
H7 |
111.854 |
|
C2 |
N1 |
H8 |
110.784 |
|
C2 |
C3 |
H11 |
110.709 |
|
C2 |
C3 |
H12 |
109.363 |
|
C3 |
C2 |
H9 |
110.501 |
|
C3 |
C2 |
H10 |
109.545 |
|
C4 |
C3 |
H11 |
106.917 |
|
C4 |
C3 |
H12 |
108.903 |
|
C4 |
O5 |
H13 |
108.729 |
|
H7 |
N1 |
H8 |
109.564 |
|
H9 |
C2 |
H10 |
108.497 |
|
H11 |
C3 |
H12 |
108.110 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.