|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3NO3 (Methyl nitrate)
1A' CS
1910171554
InChI=1S/CH3NO3/c1-5-2(3)4/h1H3 INChIKey=LRMHVVPPGGOAJQ-UHFFFAOYSA-N
B3PW91/3-21G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.0000 |
0.6381 |
0.0000 |
|
0.6364 |
0.0473 |
0.0000 |
| O2 |
-1.2520 |
0.5246 |
0.0000 |
|
0.6160 |
-1.2096 |
0.0000 |
| O3 |
0.7273 |
1.6483 |
0.0000 |
|
1.5898 |
0.8475 |
0.0000 |
| O4 |
0.7729 |
-0.6307 |
0.0000 |
|
-0.6863 |
0.7240 |
0.0000 |
| C5 |
-0.1563 |
-1.7721 |
0.0000 |
|
-1.7556 |
-0.2873 |
0.0000 |
| H6 |
0.5198 |
-2.6292 |
0.0000 |
|
-2.6605 |
0.3234 |
0.0000 |
| H7 |
-0.7838 |
-1.7711 |
0.8935 |
|
-1.7081 |
-0.9129 |
0.8935 |
| H8 |
-0.7838 |
-1.7711 |
-0.8935 |
|
-1.7081 |
-0.9129 |
-0.8935 |
Atom - Atom Distances (Å)
| |
N1 |
O2 |
O3 |
O4 |
C5 |
H6 |
H7 |
H8 |
| N1 |
|
1.2571 |
1.2447 |
1.4857 |
2.4153 |
3.3084 |
2.6864 |
2.6864 |
| O2 |
1.2571 |
| 2.2760 |
2.3312 |
2.5446 |
3.6174 |
2.5075 |
2.5075 |
| O3 |
1.2447 |
2.2760 |
| 2.2794 |
3.5327 |
4.2825 |
3.8436 |
3.8436 |
| O4 |
1.4857 |
2.3312 |
2.2794 |
|
1.4718 |
2.0144 |
2.1265 |
2.1265 |
| C5 |
2.4153 |
2.5446 |
3.5327 |
1.4718 |
|
1.0917 |
1.0918 |
1.0918 |
| H6 |
3.3084 |
3.6174 |
4.2825 |
2.0144 |
1.0917 |
| 1.7983 |
1.7983 |
| H7 |
2.6864 |
2.5075 |
3.8436 |
2.1265 |
1.0918 |
1.7983 |
| 1.7869 |
| H8 |
2.6864 |
2.5075 |
3.8436 |
2.1265 |
1.0918 |
1.7983 |
1.7869 |
|
Maximum atom distance is 4.2825Å
between atoms O3 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
O4 |
C5 |
109.505 |
|
O2 |
N1 |
O3 |
130.936 |
|
O2 |
N1 |
O4 |
116.163 |
|
O3 |
N1 |
O4 |
112.901 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O4 |
C5 |
H6 |
102.583 |
|
O4 |
C5 |
H7 |
111.230 |
|
O4 |
C5 |
H8 |
111.230 |
|
H6 |
C5 |
H7 |
110.897 |
|
H6 |
C5 |
H8 |
110.897 |
|
H7 |
C5 |
H8 |
109.840 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.