|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H6 (Dewar Benzene)
1A1 C2V
1910171554
InChI=1S/C6H6/c1-2-6-4-3-5(1)6/h1-6H INChIKey=CTLSARLLLBZBRV-UHFFFAOYSA-N
B3PW91/3-21G*
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.8038 |
0.5561 |
|
0.0000 |
0.8038 |
0.5561 |
| C2 |
0.0000 |
-0.8038 |
0.5561 |
|
0.0000 |
-0.8038 |
0.5561 |
| H3 |
0.0000 |
1.3788 |
1.4803 |
|
0.0000 |
1.3788 |
1.4803 |
| H4 |
0.0000 |
-1.3788 |
1.4803 |
|
0.0000 |
-1.3788 |
1.4803 |
| C5 |
-1.2943 |
0.6723 |
-0.2779 |
|
-1.2943 |
0.6723 |
-0.2779 |
| C6 |
1.2943 |
0.6723 |
-0.2779 |
|
1.2943 |
0.6723 |
-0.2779 |
| C7 |
1.2943 |
-0.6723 |
-0.2779 |
|
1.2943 |
-0.6723 |
-0.2779 |
| C8 |
-1.2943 |
-0.6723 |
-0.2779 |
|
-1.2943 |
-0.6723 |
-0.2779 |
| H9 |
-1.9249 |
1.4182 |
-0.7413 |
|
-1.9249 |
1.4182 |
-0.7413 |
| H10 |
1.9249 |
1.4182 |
-0.7413 |
|
1.9249 |
1.4182 |
-0.7413 |
| H11 |
1.9249 |
-1.4182 |
-0.7413 |
|
1.9249 |
-1.4182 |
-0.7413 |
| H12 |
-1.9249 |
-1.4182 |
-0.7413 |
|
-1.9249 |
-1.4182 |
-0.7413 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
H4 |
C5 |
C6 |
C7 |
C8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
| 1.6076 |
1.0885 |
2.3702 |
1.5453 |
1.5453 |
2.1329 |
2.1329 |
2.4013 |
2.4013 |
3.2134 |
3.2134 |
| C2 |
1.6076 |
| 2.3702 |
1.0885 |
2.1329 |
2.1329 |
1.5453 |
1.5453 |
3.2134 |
3.2134 |
2.4013 |
2.4013 |
| H3 |
1.0885 |
2.3702 |
| 2.7576 |
2.2947 |
2.2947 |
2.9955 |
2.9955 |
2.9398 |
2.9398 |
4.0576 |
4.0576 |
| H4 |
2.3702 |
1.0885 |
2.7576 |
| 2.9955 |
2.9955 |
2.2947 |
2.2947 |
4.0576 |
4.0576 |
2.9398 |
2.9398 |
| C5 |
1.5453 |
2.1329 |
2.2947 |
2.9955 |
| 2.5885 |
2.9169 |
1.3445 |
1.0812 |
3.3368 |
3.8663 |
2.2322 |
| C6 |
1.5453 |
2.1329 |
2.2947 |
2.9955 |
2.5885 |
|
1.3445 |
2.9169 |
3.3368 |
1.0812 |
2.2322 |
3.8663 |
| C7 |
2.1329 |
1.5453 |
2.9955 |
2.2947 |
2.9169 |
1.3445 |
| 2.5885 |
3.8663 |
2.2322 |
1.0812 |
3.3368 |
| C8 |
2.1329 |
1.5453 |
2.9955 |
2.2947 |
1.3445 |
2.9169 |
2.5885 |
| 2.2322 |
3.8663 |
3.3368 |
1.0812 |
| H9 |
2.4013 |
3.2134 |
2.9398 |
4.0576 |
1.0812 |
3.3368 |
3.8663 |
2.2322 |
| 3.8499 |
4.7819 |
2.8364 |
| H10 |
2.4013 |
3.2134 |
2.9398 |
4.0576 |
3.3368 |
1.0812 |
2.2322 |
3.8663 |
3.8499 |
| 2.8364 |
4.7819 |
| H11 |
3.2134 |
2.4013 |
4.0576 |
2.9398 |
3.8663 |
2.2322 |
1.0812 |
3.3368 |
4.7819 |
2.8364 |
| 3.8499 |
| H12 |
3.2134 |
2.4013 |
4.0576 |
2.9398 |
2.2322 |
3.8663 |
3.3368 |
1.0812 |
2.8364 |
4.7819 |
3.8499 |
|
Maximum atom distance is 4.7819Å
between atoms H9 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C4 |
121.887 |
|
C2 |
C1 |
C3 |
121.887 |
|
C2 |
C1 |
C5 |
85.118 |
|
C2 |
C1 |
C6 |
85.118 |
|
C3 |
C1 |
C5 |
120.212 |
|
C3 |
C1 |
C6 |
120.212 |
|
C5 |
C1 |
C6 |
113.765 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H7 |
85.118 |
|
C1 |
C2 |
H8 |
85.118 |
|
C1 |
C5 |
H8 |
94.882 |
|
C1 |
C5 |
H9 |
131.389 |
|
C1 |
C6 |
H7 |
94.882 |
|
C1 |
C6 |
H10 |
131.389 |
|
C2 |
H7 |
C6 |
94.882 |
|
C2 |
H7 |
H11 |
131.389 |
|
C2 |
H8 |
C5 |
94.882 |
|
C2 |
H8 |
H12 |
131.389 |
|
C4 |
C2 |
H7 |
120.212 |
|
C4 |
C2 |
H8 |
120.212 |
|
C5 |
H8 |
H12 |
133.626 |
|
C6 |
H7 |
H11 |
133.626 |
|
H7 |
C6 |
H10 |
133.626 |
|
H8 |
C5 |
H9 |
133.626 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.