|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CH2COOH (Propanoic Acid)
1A' CS
1910171554
InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) INChIKey=XBDQKXXYIPTUBI-UHFFFAOYSA-N
HF/3-21G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.5601 |
0.0000 |
|
0.5505 |
-0.1031 |
0.0000 |
| C2 |
-0.6046 |
-0.8138 |
0.0000 |
|
-0.9112 |
-0.4444 |
0.0000 |
| C3 |
0.4745 |
-1.9002 |
0.0000 |
|
-1.7803 |
0.8162 |
0.0000 |
| O4 |
-0.9665 |
1.5151 |
0.0000 |
|
1.3113 |
-1.2289 |
0.0000 |
| O5 |
1.1706 |
0.8343 |
0.0000 |
|
1.0356 |
0.9970 |
0.0000 |
| H6 |
-1.2475 |
-0.8896 |
0.8696 |
|
-1.1041 |
-1.0624 |
0.8696 |
| H7 |
-1.2475 |
-0.8896 |
-0.8696 |
|
-1.1041 |
-1.0624 |
-0.8696 |
| H8 |
0.0215 |
-2.8836 |
0.0000 |
|
-2.8303 |
0.5520 |
0.0000 |
| H9 |
1.1056 |
-1.8084 |
-0.8743 |
|
-1.5740 |
1.4197 |
-0.8743 |
| H10 |
1.1056 |
-1.8084 |
0.8743 |
|
-1.5740 |
1.4197 |
0.8743 |
| H11 |
-0.5899 |
2.4075 |
0.0000 |
|
2.2577 |
-1.0231 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
O4 |
O5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
|
1.5011 |
2.5056 |
1.3587 |
1.2023 |
2.1010 |
2.1010 |
3.4438 |
2.7562 |
2.7562 |
1.9393 |
| C2 |
1.5011 |
|
1.5312 |
2.3569 |
2.4223 |
1.0841 |
1.0841 |
2.1624 |
2.1630 |
2.1630 |
3.2213 |
| C3 |
2.5056 |
1.5312 |
| 3.7068 |
2.8217 |
2.1777 |
2.1777 |
1.0828 |
1.0822 |
1.0822 |
4.4372 |
| O4 |
1.3587 |
2.3569 |
3.7068 |
| 2.2430 |
2.5725 |
2.5725 |
4.5083 |
4.0130 |
4.0130 |
0.9685 |
| O5 |
1.2023 |
2.4223 |
2.8217 |
2.2430 |
| 3.0944 |
3.0944 |
3.8914 |
2.7844 |
2.7844 |
2.3610 |
| H6 |
2.1010 |
1.0841 |
2.1777 |
2.5725 |
3.0944 |
| 1.7392 |
2.5184 |
3.0696 |
2.5261 |
3.4727 |
| H7 |
2.1010 |
1.0841 |
2.1777 |
2.5725 |
3.0944 |
1.7392 |
| 2.5184 |
2.5261 |
3.0696 |
3.4727 |
| H8 |
3.4438 |
2.1624 |
1.0828 |
4.5083 |
3.8914 |
2.5184 |
2.5184 |
| 1.7594 |
1.7594 |
5.3263 |
| H9 |
2.7562 |
2.1630 |
1.0822 |
4.0130 |
2.7844 |
3.0696 |
2.5261 |
1.7594 |
| 1.7485 |
4.6274 |
| H10 |
2.7562 |
2.1630 |
1.0822 |
4.0130 |
2.7844 |
2.5261 |
3.0696 |
1.7594 |
1.7485 |
| 4.6274 |
| H11 |
1.9393 |
3.2213 |
4.4372 |
0.9685 |
2.3610 |
3.4727 |
3.4727 |
5.3263 |
4.6274 |
4.6274 |
|
Maximum atom distance is 5.3263Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
C3 |
111.440 |
|
C2 |
C1 |
O4 |
110.905 |
|
C2 |
C1 |
O5 |
126.935 |
|
O4 |
C1 |
O5 |
122.160 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
107.630 |
|
C1 |
C2 |
H7 |
107.630 |
|
C1 |
O4 |
H11 |
111.779 |
|
C2 |
C3 |
H8 |
110.462 |
|
C2 |
C3 |
H9 |
110.541 |
|
C2 |
C3 |
H10 |
110.541 |
|
C3 |
C2 |
H6 |
111.611 |
|
C3 |
C2 |
H7 |
111.611 |
|
H6 |
C2 |
H7 |
106.672 |
|
H8 |
C3 |
H9 |
108.722 |
|
H8 |
C3 |
H10 |
108.722 |
|
H9 |
C3 |
H10 |
107.779 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.