|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHBrCH3 (i-propyl bromide)
1A' CS
1910171554
InChI=1S/C3H7Br/c1-3(2)4/h3H,1-2H3 INChIKey=NAMYKGVDVNBCFQ-UHFFFAOYSA-N
MP2/3-21G*
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.4711 |
-0.9011 |
0.0000 |
|
-0.9227 |
0.0000 |
0.4272 |
| Br2 |
-0.0678 |
1.0091 |
0.0000 |
|
1.0112 |
0.0000 |
-0.0193 |
| H3 |
1.5630 |
-0.8796 |
0.0000 |
|
-0.9537 |
0.0000 |
1.5190 |
| C4 |
-0.0678 |
-1.5581 |
1.2822 |
|
-1.5531 |
1.2822 |
-0.1426 |
| C5 |
-0.0678 |
-1.5581 |
-1.2822 |
|
-1.5531 |
-1.2822 |
-0.1426 |
| H6 |
-1.1608 |
-1.5087 |
1.2913 |
|
-1.4512 |
1.2913 |
-1.2319 |
| H7 |
0.2433 |
-2.6099 |
1.3081 |
|
-2.6186 |
1.3081 |
0.1176 |
| H8 |
0.3170 |
-1.0493 |
2.1701 |
|
-1.0634 |
2.1701 |
0.2662 |
| H9 |
-1.1608 |
-1.5087 |
-1.2913 |
|
-1.4512 |
-1.2913 |
-1.2319 |
| H10 |
0.2433 |
-2.6099 |
-1.3081 |
|
-2.6186 |
-1.3081 |
0.1176 |
| H11 |
0.3170 |
-1.0493 |
-2.1701 |
|
-1.0634 |
-2.1701 |
0.2662 |
Atom - Atom Distances (Å)
| |
C1 |
Br2 |
H3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
| C1 |
| 1.9848 |
1.0922 |
1.5383 |
1.5383 |
2.1678 |
2.1641 |
2.1806 |
2.1678 |
2.1641 |
2.1806 |
| Br2 |
1.9848 |
| 2.4955 |
2.8697 |
2.8697 |
3.0334 |
3.8608 |
3.0158 |
3.0334 |
3.8608 |
3.0158 |
| H3 |
1.0922 |
2.4955 |
| 2.1827 |
2.1827 |
3.0794 |
2.5391 |
2.5081 |
3.0794 |
2.5391 |
2.5081 |
| C4 |
1.5383 |
2.8697 |
2.1827 |
| 2.5644 |
1.0941 |
1.0972 |
1.0933 |
2.7964 |
2.8130 |
3.5108 |
| C5 |
1.5383 |
2.8697 |
2.1827 |
2.5644 |
| 2.7964 |
2.8130 |
3.5108 |
1.0941 |
1.0972 |
1.0933 |
| H6 |
2.1678 |
3.0334 |
3.0794 |
1.0941 |
2.7964 |
| 1.7845 |
1.7797 |
2.5826 |
3.1530 |
3.7916 |
| H7 |
2.1641 |
3.8608 |
2.5391 |
1.0972 |
2.8130 |
1.7845 |
| 1.7843 |
3.1530 |
2.6163 |
3.8130 |
| H8 |
2.1806 |
3.0158 |
2.5081 |
1.0933 |
3.5108 |
1.7797 |
1.7843 |
| 3.7916 |
3.8130 |
4.3402 |
| H9 |
2.1678 |
3.0334 |
3.0794 |
2.7964 |
1.0941 |
2.5826 |
3.1530 |
3.7916 |
| 1.7845 |
1.7797 |
| H10 |
2.1641 |
3.8608 |
2.5391 |
2.8130 |
1.0972 |
3.1530 |
2.6163 |
3.8130 |
1.7845 |
| 1.7843 |
| H11 |
2.1806 |
3.0158 |
2.5081 |
3.5108 |
1.0933 |
3.7916 |
3.8130 |
4.3402 |
1.7797 |
1.7843 |
|
Maximum atom distance is 4.3402Å
between atoms H8 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
Br2 |
C1 |
C4 |
108.420 |
|
Br2 |
C1 |
C5 |
108.420 |
|
C4 |
C1 |
C5 |
112.931 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C4 |
H6 |
109.730 |
|
C1 |
C4 |
H7 |
109.257 |
|
C1 |
C4 |
H8 |
110.782 |
|
C1 |
C5 |
H9 |
109.730 |
|
C1 |
C5 |
H10 |
109.257 |
|
C1 |
C5 |
H11 |
110.782 |
|
Br2 |
C1 |
H3 |
104.629 |
|
H3 |
C1 |
C4 |
111.018 |
|
H3 |
C1 |
C5 |
111.018 |
|
H6 |
C4 |
H7 |
109.054 |
|
H6 |
C4 |
H8 |
108.898 |
|
H7 |
C4 |
H8 |
109.093 |
|
H9 |
C5 |
H10 |
109.054 |
|
H9 |
C5 |
H11 |
108.898 |
|
H10 |
C5 |
H11 |
109.093 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.