|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C5H6 (1-Buten-3-yne, 2-methyl-)
1A' CS
1910171554
InChI=1S/C5H6/c1-4-5(2)3/h1H,2H2,3H3 INChIKey=BOFLDKIFLIFLJA-UHFFFAOYSA-N
B3LYP/6-31G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-1.4760 |
0.7931 |
0.0000 |
|
0.3633 |
-1.6357 |
0.0000 |
| H2 |
-1.6177 |
1.8776 |
0.0000 |
|
1.3688 |
-2.0661 |
0.0000 |
| H3 |
-1.9770 |
0.3762 |
0.8823 |
|
-0.1738 |
-2.0049 |
0.8823 |
| H4 |
-1.9770 |
0.3762 |
-0.8823 |
|
-0.1738 |
-2.0049 |
-0.8823 |
| C5 |
0.5375 |
-2.1538 |
0.0000 |
|
-1.9275 |
1.1012 |
0.0000 |
| H6 |
0.7462 |
-3.1974 |
0.0000 |
|
-2.8754 |
1.5849 |
0.0000 |
| C7 |
0.3178 |
-0.9579 |
0.0000 |
|
-0.8359 |
0.5655 |
0.0000 |
| C8 |
0.0000 |
0.4412 |
0.0000 |
|
0.4247 |
-0.1196 |
0.0000 |
| C9 |
0.9680 |
1.3797 |
0.0000 |
|
1.5905 |
0.5578 |
0.0000 |
| H10 |
2.0200 |
1.1166 |
0.0000 |
|
1.6223 |
1.6417 |
0.0000 |
| H11 |
0.7217 |
2.4367 |
0.0000 |
|
2.5411 |
0.0342 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
H3 |
H4 |
C5 |
H6 |
C7 |
C8 |
C9 |
H10 |
H11 |
| C1 |
|
1.0938 |
1.0969 |
1.0969 |
3.5691 |
4.5675 |
2.5067 |
1.5174 |
2.5135 |
3.5110 |
2.7444 |
| H2 |
1.0938 |
| 1.7782 |
1.7782 |
4.5714 |
5.5985 |
3.4331 |
2.1634 |
2.6332 |
3.7165 |
2.4053 |
| H3 |
1.0969 |
1.7782 |
| 1.7645 |
3.6745 |
4.5787 |
2.7971 |
2.1659 |
3.2340 |
4.1596 |
3.5082 |
| H4 |
1.0969 |
1.7782 |
1.7645 |
| 3.6745 |
4.5787 |
2.7971 |
2.1659 |
3.2340 |
4.1596 |
3.5082 |
| C5 |
3.5691 |
4.5714 |
3.6745 |
3.6745 |
|
1.0642 |
1.2159 |
2.6501 |
3.5597 |
3.5907 |
4.5942 |
| H6 |
4.5675 |
5.5985 |
4.5787 |
4.5787 |
1.0642 |
| 2.2801 |
3.7143 |
4.5825 |
4.4981 |
5.6341 |
| C7 |
2.5067 |
3.4331 |
2.7971 |
2.7971 |
1.2159 |
2.2801 |
|
1.4348 |
2.4264 |
2.6835 |
3.4186 |
| C8 |
1.5174 |
2.1634 |
2.1659 |
2.1659 |
2.6501 |
3.7143 |
1.4348 |
|
1.3483 |
2.1299 |
2.1220 |
| C9 |
2.5135 |
2.6332 |
3.2340 |
3.2340 |
3.5597 |
4.5825 |
2.4264 |
1.3483 |
|
1.0844 |
1.0853 |
| H10 |
3.5110 |
3.7165 |
4.1596 |
4.1596 |
3.5907 |
4.4981 |
2.6835 |
2.1299 |
1.0844 |
| 1.8515 |
| H11 |
2.7444 |
2.4053 |
3.5082 |
3.5082 |
4.5942 |
5.6341 |
3.4186 |
2.1220 |
1.0853 |
1.8515 |
|
Maximum atom distance is 5.6341Å
between atoms H6 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C8 |
C7 |
116.203 |
|
C1 |
C8 |
C9 |
122.479 |
|
C5 |
C7 |
C8 |
177.618 |
|
C7 |
C8 |
C9 |
121.318 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
H3 |
108.526 |
|
H2 |
C1 |
H4 |
108.526 |
|
H2 |
C1 |
C8 |
110.850 |
|
H3 |
C1 |
H4 |
107.092 |
|
H3 |
C1 |
C8 |
110.862 |
|
H4 |
C1 |
C8 |
110.862 |
|
H6 |
C5 |
C7 |
179.107 |
|
C8 |
C9 |
H10 |
121.842 |
|
C8 |
C9 |
H11 |
120.996 |
|
H10 |
C9 |
H11 |
117.161 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.