|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3COCH3 (Acetone)
1A1 C2V
1910171554
InChI=1S/C3H6O/c1-3(2)4/h1-2H3 INChIKey=CSCPPACGZOOCGX-UHFFFAOYSA-N
B3LYP/6-31G
Point group is C2
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
0.1738 |
|
0.0000 |
0.1738 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
1.4153 |
|
0.0000 |
1.4153 |
0.0000 |
| C3 |
0.0000 |
1.2921 |
-0.6180 |
|
1.2921 |
-0.6180 |
-0.0000 |
| C4 |
0.0000 |
-1.2921 |
-0.6180 |
|
-1.2921 |
-0.6180 |
0.0000 |
| H5 |
-0.0005 |
2.1447 |
0.0634 |
|
2.1447 |
0.0634 |
-0.0006 |
| H6 |
0.0005 |
-2.1447 |
0.0634 |
|
-2.1447 |
0.0634 |
0.0006 |
| H7 |
0.8824 |
1.3462 |
-1.2684 |
|
1.3462 |
-1.2684 |
0.8824 |
| H8 |
-0.8818 |
1.3457 |
-1.2693 |
|
1.3457 |
-1.2693 |
-0.8818 |
| H9 |
-0.8824 |
-1.3462 |
-1.2684 |
|
-1.3462 |
-1.2684 |
-0.8824 |
| H10 |
0.8818 |
-1.3457 |
-1.2693 |
|
-1.3457 |
-1.2693 |
0.8818 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
C3 |
C4 |
H5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.2415 |
1.5154 |
1.5154 |
2.1475 |
2.1475 |
2.1612 |
2.1613 |
2.1612 |
2.1613 |
| O2 |
1.2415 |
| 2.4091 |
2.4091 |
2.5352 |
2.5352 |
3.1294 |
3.1298 |
3.1294 |
3.1298 |
| C3 |
1.5154 |
2.4091 |
| 2.5842 |
1.0914 |
3.5037 |
1.0975 |
1.0975 |
2.8569 |
2.8565 |
| C4 |
1.5154 |
2.4091 |
2.5842 |
| 3.5037 |
1.0914 |
2.8569 |
2.8565 |
1.0975 |
1.0975 |
| H5 |
2.1475 |
2.5352 |
1.0914 |
3.5037 |
| 4.2894 |
1.7863 |
1.7863 |
3.8389 |
3.8389 |
| H6 |
2.1475 |
2.5352 |
3.5037 |
1.0914 |
4.2894 |
| 3.8389 |
3.8389 |
1.7863 |
1.7863 |
| H7 |
2.1612 |
3.1294 |
1.0975 |
2.8569 |
1.7863 |
3.8389 |
| 1.7642 |
3.2192 |
2.6919 |
| H8 |
2.1613 |
3.1298 |
1.0975 |
2.8565 |
1.7863 |
3.8389 |
1.7642 |
| 2.6919 |
3.2177 |
| H9 |
2.1612 |
3.1294 |
2.8569 |
1.0975 |
3.8389 |
1.7863 |
3.2192 |
2.6919 |
| 1.7642 |
| H10 |
2.1613 |
3.1298 |
2.8565 |
1.0975 |
3.8389 |
1.7863 |
2.6919 |
3.2177 |
1.7642 |
|
Maximum atom distance is 4.2894Å
between atoms H5 and H6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
O2 |
C1 |
C3 |
121.502 |
|
O2 |
C1 |
C4 |
121.502 |
|
C3 |
C1 |
C4 |
116.997 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H5 |
109.866 |
|
C1 |
C3 |
H7 |
110.588 |
|
C1 |
C3 |
H8 |
110.592 |
|
C1 |
C4 |
H6 |
109.866 |
|
C1 |
C4 |
H9 |
110.588 |
|
C1 |
C4 |
H10 |
110.592 |
|
H5 |
C3 |
H7 |
109.382 |
|
H5 |
C3 |
H8 |
109.385 |
|
H6 |
C4 |
H9 |
109.382 |
|
H6 |
C4 |
H10 |
109.385 |
|
H7 |
C3 |
H8 |
106.973 |
|
H9 |
C4 |
H10 |
106.973 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.