|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH3CHF2 (Ethane, 1,1-difluoro-)
1A' CS
1910171554
InChI=1S/C2H4F2/c1-2(3)4/h2H,1H3 INChIKey=NPNPZTNLOVBDOC-UHFFFAOYSA-N
HSEh1PBE/6-31G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.3253 |
0.1837 |
0.0000 |
|
0.1941 |
0.2611 |
0.1837 |
| C2 |
-0.9051 |
1.0317 |
0.0000 |
|
-0.5399 |
-0.7265 |
1.0317 |
| H3 |
1.2689 |
0.7316 |
0.0000 |
|
0.7569 |
1.0184 |
0.7316 |
| F4 |
0.3253 |
-0.6525 |
1.1332 |
|
1.1036 |
-0.4149 |
-0.6525 |
| F5 |
0.3253 |
-0.6525 |
-1.1332 |
|
-0.7154 |
0.9371 |
-0.6525 |
| H6 |
-1.7887 |
0.3895 |
0.0000 |
|
-1.0670 |
-1.4356 |
0.3895 |
| H7 |
-0.9289 |
1.6656 |
0.8890 |
|
0.1594 |
-1.2758 |
1.6656 |
| H8 |
-0.9289 |
1.6656 |
-0.8890 |
|
-1.2676 |
-0.2152 |
1.6656 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
H3 |
F4 |
F5 |
H6 |
H7 |
H8 |
| C1 |
|
1.4944 |
1.0911 |
1.4083 |
1.4083 |
2.1240 |
2.1352 |
2.1352 |
| C2 |
1.4944 |
| 2.1947 |
2.3737 |
2.3737 |
1.0923 |
1.0921 |
1.0921 |
| H3 |
1.0911 |
2.1947 |
| 2.0224 |
2.0224 |
3.0767 |
2.5481 |
2.5481 |
| F4 |
1.4083 |
2.3737 |
2.0224 |
| 2.2664 |
2.6152 |
2.6469 |
3.3220 |
| F5 |
1.4083 |
2.3737 |
2.0224 |
2.2664 |
| 2.6152 |
3.3220 |
2.6469 |
| H6 |
2.1240 |
1.0923 |
3.0767 |
2.6152 |
2.6152 |
| 1.7771 |
1.7771 |
| H7 |
2.1352 |
1.0921 |
2.5481 |
2.6469 |
3.3220 |
1.7771 |
| 1.7779 |
| H8 |
2.1352 |
1.0921 |
2.5481 |
3.3220 |
2.6469 |
1.7771 |
1.7779 |
|
Maximum atom distance is 3.3220Å
between atoms F4 and H8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C1 |
F4 |
109.689 |
|
C2 |
C1 |
F5 |
109.689 |
|
F4 |
C1 |
F5 |
107.153 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
H6 |
109.417 |
|
C1 |
C2 |
H7 |
110.321 |
|
C1 |
C2 |
H8 |
110.321 |
|
C2 |
C1 |
H3 |
115.288 |
|
H3 |
C1 |
F4 |
107.346 |
|
H3 |
C1 |
F5 |
107.346 |
|
H6 |
C2 |
H7 |
108.886 |
|
H6 |
C2 |
H8 |
108.886 |
|
H7 |
C2 |
H8 |
108.978 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.