|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for (Propanenitrile, 2-methyl-)
1A' CS
1910171554
InChI=1S/C4H7N/c1-4(2)3-5/h4H,1-2H3 INChIKey=LRDFRRGEGBBSRN-UHFFFAOYSA-N
B2PLYP=FULL/6-31G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| N1 |
0.4113 |
-2.2094 |
0.0000 |
|
-2.2431 |
0.0000 |
0.1378 |
| C2 |
0.0256 |
-1.0915 |
0.0000 |
|
-1.0864 |
0.0000 |
-0.1081 |
| C3 |
-0.4410 |
0.3095 |
0.0000 |
|
0.3611 |
0.0000 |
-0.3998 |
| C4 |
0.0256 |
1.0419 |
1.2808 |
|
1.0310 |
1.2808 |
0.1530 |
| C5 |
0.0256 |
1.0419 |
-1.2808 |
|
1.0310 |
-1.2808 |
0.1530 |
| H6 |
-1.5395 |
0.2820 |
0.0000 |
|
0.4683 |
0.0000 |
-1.4934 |
| H7 |
-0.3698 |
2.0626 |
1.2836 |
|
2.0923 |
1.2836 |
-0.1146 |
| H8 |
-0.3262 |
0.5302 |
2.1809 |
|
0.5661 |
2.1809 |
-0.2589 |
| H9 |
1.1184 |
1.0936 |
1.3171 |
|
0.9485 |
1.3171 |
1.2438 |
| H10 |
-0.3698 |
2.0626 |
-1.2836 |
|
2.0923 |
-1.2836 |
-0.1146 |
| H11 |
-0.3262 |
0.5302 |
-2.1809 |
|
0.5661 |
-2.1809 |
-0.2589 |
| H12 |
1.1184 |
1.0936 |
-1.3171 |
|
0.9485 |
-1.3171 |
1.2438 |
Atom - Atom Distances (Å)
| |
N1 |
C2 |
C3 |
C4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
H11 |
H12 |
| N1 |
|
1.1826 |
2.6592 |
3.5158 |
3.5158 |
3.1643 |
4.5286 |
3.5785 |
3.6255 |
4.5286 |
3.5785 |
3.6255 |
| C2 |
1.1826 |
|
1.4766 |
2.4884 |
2.4884 |
2.0823 |
3.4282 |
2.7405 |
2.7755 |
3.4282 |
2.7405 |
2.7755 |
| C3 |
2.6592 |
1.4766 |
|
1.5475 |
1.5475 |
1.0988 |
2.1740 |
2.1951 |
2.1866 |
2.1740 |
2.1951 |
2.1866 |
| C4 |
3.5158 |
2.4884 |
1.5475 |
| 2.5616 |
2.1604 |
1.0946 |
1.0936 |
1.0945 |
2.7882 |
3.5170 |
2.8188 |
| C5 |
3.5158 |
2.4884 |
1.5475 |
2.5616 |
| 2.1604 |
2.7882 |
3.5170 |
2.8188 |
1.0946 |
1.0936 |
1.0945 |
| H6 |
3.1643 |
2.0823 |
1.0988 |
2.1604 |
2.1604 |
| 2.4872 |
2.5080 |
3.0753 |
2.4872 |
2.5080 |
3.0753 |
| H7 |
4.5286 |
3.4282 |
2.1740 |
1.0946 |
2.7882 |
2.4872 |
| 1.7764 |
1.7762 |
2.5672 |
3.7886 |
3.1492 |
| H8 |
3.5785 |
2.7405 |
2.1951 |
1.0936 |
3.5170 |
2.5080 |
1.7764 |
| 1.7750 |
3.7886 |
4.3619 |
3.8263 |
| H9 |
3.6255 |
2.7755 |
2.1866 |
1.0945 |
2.8188 |
3.0753 |
1.7762 |
1.7750 |
| 3.1492 |
3.8263 |
2.6341 |
| H10 |
4.5286 |
3.4282 |
2.1740 |
2.7882 |
1.0946 |
2.4872 |
2.5672 |
3.7886 |
3.1492 |
| 1.7764 |
1.7762 |
| H11 |
3.5785 |
2.7405 |
2.1951 |
3.5170 |
1.0936 |
2.5080 |
3.7886 |
4.3619 |
3.8263 |
1.7764 |
| 1.7750 |
| H12 |
3.6255 |
2.7755 |
2.1866 |
2.8188 |
1.0945 |
3.0753 |
3.1492 |
3.8263 |
2.6341 |
1.7762 |
1.7750 |
|
Maximum atom distance is 4.5286Å
between atoms N1 and H7.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
N1 |
C2 |
C3 |
179.387 |
|
C2 |
C3 |
C4 |
110.719 |
|
C2 |
C3 |
C5 |
110.719 |
|
C4 |
C3 |
C5 |
111.719 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C2 |
C3 |
H6 |
106.991 |
|
C3 |
C4 |
H7 |
109.545 |
|
C3 |
C4 |
H8 |
111.267 |
|
C3 |
C4 |
H9 |
110.536 |
|
C3 |
C5 |
H10 |
109.545 |
|
C3 |
C5 |
H11 |
111.267 |
|
C3 |
C5 |
H12 |
110.536 |
|
C4 |
C3 |
H6 |
108.257 |
|
C5 |
C3 |
H6 |
108.257 |
|
H7 |
C4 |
H8 |
108.543 |
|
H7 |
C4 |
H9 |
108.457 |
|
H8 |
C4 |
H9 |
108.423 |
|
H10 |
C5 |
H11 |
108.543 |
|
H10 |
C5 |
H12 |
108.457 |
|
H11 |
C5 |
H12 |
108.423 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.