|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHFCl2 (fluorodichloromethane)
1A' CS
1910171554
InChI=1S/CHCl2F/c2-1(3)4/h1H INChIKey=UMNKXPULIDJLSU-UHFFFAOYSA-N
MP2=FULL/6-31G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.1905 |
0.5464 |
0.0000 |
|
-0.2677 |
0.4763 |
-0.1905 |
| H2 |
-1.0770 |
1.1727 |
0.0000 |
|
-0.5745 |
1.0223 |
-1.0770 |
| F3 |
0.9664 |
1.3529 |
0.0000 |
|
-0.6629 |
1.1794 |
0.9664 |
| Cl4 |
-0.1905 |
-0.4890 |
1.5333 |
|
1.5763 |
0.3249 |
-0.1905 |
| Cl5 |
-0.1905 |
-0.4890 |
-1.5333 |
|
-1.0971 |
-1.1776 |
-0.1905 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
F3 |
Cl4 |
Cl5 |
| C1 |
|
1.0854 |
1.4103 |
1.8502 |
1.8502 |
| H2 |
1.0854 |
| 2.0513 |
2.4286 |
2.4286 |
| F3 |
1.4103 |
2.0513 |
| 2.6613 |
2.6613 |
| Cl4 |
1.8502 |
2.4286 |
2.6613 |
| 3.0667 |
| Cl5 |
1.8502 |
2.4286 |
2.6613 |
3.0667 |
|
Maximum atom distance is 3.0667Å
between atoms Cl4 and Cl5.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
Cl4 |
108.667 |
|
F3 |
C1 |
Cl5 |
108.667 |
|
Cl4 |
C1 |
Cl5 |
111.937 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
109.878 |
|
H2 |
C1 |
Cl4 |
108.839 |
|
H2 |
C1 |
Cl5 |
108.839 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.