|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C5H6 (1-Buten-3-yne, 2-methyl-)
1A' CS
1910171554
InChI=1S/C5H6/c1-4-5(2)3/h1H,2H2,3H3 INChIKey=BOFLDKIFLIFLJA-UHFFFAOYSA-N
B3PW91/6-31G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-1.4699 |
0.7974 |
0.0000 |
|
0.3771 |
-1.6291 |
0.0000 |
| H2 |
-1.6071 |
1.8822 |
0.0000 |
|
1.3863 |
-2.0504 |
0.0000 |
| H3 |
-1.9715 |
0.3824 |
0.8823 |
|
-0.1564 |
-2.0022 |
0.8823 |
| H4 |
-1.9715 |
0.3824 |
-0.8823 |
|
-0.1564 |
-2.0022 |
-0.8823 |
| C5 |
0.5296 |
-2.1536 |
0.0000 |
|
-1.9348 |
1.0840 |
0.0000 |
| H6 |
0.7342 |
-3.1987 |
0.0000 |
|
-2.8876 |
1.5595 |
0.0000 |
| C7 |
0.3121 |
-0.9567 |
0.0000 |
|
-0.8391 |
0.5556 |
0.0000 |
| C8 |
0.0000 |
0.4412 |
0.0000 |
|
0.4252 |
-0.1175 |
0.0000 |
| C9 |
0.9721 |
1.3742 |
0.0000 |
|
1.5835 |
0.5710 |
0.0000 |
| H10 |
2.0227 |
1.1049 |
0.0000 |
|
1.6036 |
1.6554 |
0.0000 |
| H11 |
0.7298 |
2.4323 |
0.0000 |
|
2.5388 |
0.0557 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
H3 |
H4 |
C5 |
H6 |
C7 |
C8 |
C9 |
H10 |
H11 |
| C1 |
|
1.0935 |
1.0965 |
1.0965 |
3.5646 |
4.5636 |
2.5005 |
1.5124 |
2.5092 |
3.5060 |
2.7407 |
| H2 |
1.0935 |
| 1.7778 |
1.7778 |
4.5666 |
5.5944 |
3.4268 |
2.1586 |
2.6288 |
3.7121 |
2.4008 |
| H3 |
1.0965 |
1.7778 |
| 1.7647 |
3.6696 |
4.5742 |
2.7905 |
2.1607 |
3.2291 |
4.1538 |
3.5039 |
| H4 |
1.0965 |
1.7778 |
1.7647 |
| 3.6696 |
4.5742 |
2.7905 |
2.1607 |
3.2291 |
4.1538 |
3.5039 |
| C5 |
3.5646 |
4.5666 |
3.6696 |
3.6696 |
|
1.0649 |
1.2165 |
2.6483 |
3.5555 |
3.5843 |
4.5903 |
| H6 |
4.5636 |
5.5944 |
4.5742 |
4.5742 |
1.0649 |
| 2.2813 |
3.7131 |
4.5791 |
4.4923 |
5.6310 |
| C7 |
2.5005 |
3.4268 |
2.7905 |
2.7905 |
1.2165 |
2.2813 |
|
1.4323 |
2.4226 |
2.6789 |
3.4147 |
| C8 |
1.5124 |
2.1586 |
2.1607 |
2.1607 |
2.6483 |
3.7131 |
1.4323 |
|
1.3474 |
2.1288 |
2.1206 |
| C9 |
2.5092 |
2.6288 |
3.2291 |
3.2291 |
3.5555 |
4.5791 |
2.4226 |
1.3474 |
|
1.0846 |
1.0854 |
| H10 |
3.5060 |
3.7121 |
4.1538 |
4.1538 |
3.5843 |
4.4923 |
2.6789 |
2.1288 |
1.0846 |
| 1.8530 |
| H11 |
2.7407 |
2.4008 |
3.5039 |
3.5039 |
4.5903 |
5.6310 |
3.4147 |
2.1206 |
1.0854 |
1.8530 |
|
Maximum atom distance is 5.6310Å
between atoms H6 and H11.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C8 |
C7 |
116.209 |
|
C1 |
C8 |
C9 |
122.550 |
|
C5 |
C7 |
C8 |
177.714 |
|
C7 |
C8 |
C9 |
121.242 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
H3 |
108.542 |
|
H2 |
C1 |
H4 |
108.542 |
|
H2 |
C1 |
C8 |
110.834 |
|
H3 |
C1 |
H4 |
107.158 |
|
H3 |
C1 |
C8 |
110.823 |
|
H4 |
C1 |
C8 |
110.823 |
|
H6 |
C5 |
C7 |
179.227 |
|
C8 |
C9 |
H10 |
121.792 |
|
C8 |
C9 |
H11 |
120.928 |
|
H10 |
C9 |
H11 |
117.279 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.