|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for C6H4F2 (1,4-difluorobenzene)
1Ag D2H
1910171554
InChI=1S/C6H4F2/c7-5-1-2-6(8)4-3-5/h1-4H INChIKey=QUGUFLJIAFISSW-UHFFFAOYSA-N
BLYP/6-31G
Point group is D2h
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
1.3780 |
|
1.3780 |
0.0000 |
0.0000 |
| C2 |
0.0000 |
0.0000 |
-1.3780 |
|
-1.3780 |
0.0000 |
0.0000 |
| C3 |
0.0000 |
1.2311 |
0.7047 |
|
0.7047 |
1.2311 |
0.0000 |
| C4 |
0.0000 |
-1.2311 |
0.7047 |
|
0.7047 |
-1.2311 |
0.0000 |
| C5 |
0.0000 |
-1.2311 |
-0.7047 |
|
-0.7047 |
-1.2311 |
0.0000 |
| C6 |
0.0000 |
1.2311 |
-0.7047 |
|
-0.7047 |
1.2311 |
0.0000 |
| F7 |
0.0000 |
0.0000 |
2.7850 |
|
2.7850 |
0.0000 |
0.0000 |
| F8 |
0.0000 |
0.0000 |
-2.7850 |
|
-2.7850 |
0.0000 |
0.0000 |
| H9 |
0.0000 |
2.1622 |
1.2713 |
|
1.2713 |
2.1622 |
0.0000 |
| H10 |
0.0000 |
-2.1622 |
1.2713 |
|
1.2713 |
-2.1622 |
0.0000 |
| H11 |
0.0000 |
-2.1622 |
-1.2713 |
|
-1.2713 |
-2.1622 |
0.0000 |
| H12 |
0.0000 |
2.1622 |
-1.2713 |
|
-1.2713 |
2.1622 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
C3 |
C4 |
C5 |
C6 |
F7 |
F8 |
H9 |
H10 |
H11 |
H12 |
| C1 |
| 2.7561 |
1.4032 |
1.4032 |
2.4194 |
2.4194 |
1.4070 |
4.1631 |
2.1649 |
2.1649 |
3.4197 |
3.4197 |
| C2 |
2.7561 |
| 2.4194 |
2.4194 |
1.4032 |
1.4032 |
4.1631 |
1.4070 |
3.4197 |
3.4197 |
2.1649 |
2.1649 |
| C3 |
1.4032 |
2.4194 |
| 2.4623 |
2.8371 |
1.4094 |
2.4173 |
3.7005 |
1.0899 |
3.4404 |
3.9268 |
2.1844 |
| C4 |
1.4032 |
2.4194 |
2.4623 |
|
1.4094 |
2.8371 |
2.4173 |
3.7005 |
3.4404 |
1.0899 |
2.1844 |
3.9268 |
| C5 |
2.4194 |
1.4032 |
2.8371 |
1.4094 |
| 2.4623 |
3.7005 |
2.4173 |
3.9268 |
2.1844 |
1.0899 |
3.4404 |
| C6 |
2.4194 |
1.4032 |
1.4094 |
2.8371 |
2.4623 |
| 3.7005 |
2.4173 |
2.1844 |
3.9268 |
3.4404 |
1.0899 |
| F7 |
1.4070 |
4.1631 |
2.4173 |
2.4173 |
3.7005 |
3.7005 |
| 5.5701 |
2.6394 |
2.6394 |
4.5966 |
4.5966 |
| F8 |
4.1631 |
1.4070 |
3.7005 |
3.7005 |
2.4173 |
2.4173 |
5.5701 |
| 4.5966 |
4.5966 |
2.6394 |
2.6394 |
| H9 |
2.1649 |
3.4197 |
1.0899 |
3.4404 |
3.9268 |
2.1844 |
2.6394 |
4.5966 |
| 4.3245 |
5.0165 |
2.5426 |
| H10 |
2.1649 |
3.4197 |
3.4404 |
1.0899 |
2.1844 |
3.9268 |
2.6394 |
4.5966 |
4.3245 |
| 2.5426 |
5.0165 |
| H11 |
3.4197 |
2.1649 |
3.9268 |
2.1844 |
1.0899 |
3.4404 |
4.5966 |
2.6394 |
5.0165 |
2.5426 |
| 4.3245 |
| H12 |
3.4197 |
2.1649 |
2.1844 |
3.9268 |
3.4404 |
1.0899 |
4.5966 |
2.6394 |
2.5426 |
5.0165 |
4.3245 |
|
Maximum atom distance is 5.5701Å
between atoms F7 and F8.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
C6 |
118.675 |
|
C1 |
C4 |
C5 |
118.675 |
|
C2 |
C5 |
C4 |
118.675 |
|
C2 |
C6 |
C3 |
118.675 |
|
C3 |
C1 |
C4 |
122.649 |
|
C3 |
C1 |
F7 |
118.675 |
|
C4 |
C1 |
F7 |
118.675 |
|
C5 |
C2 |
C6 |
122.649 |
|
C5 |
C2 |
F8 |
118.675 |
|
C6 |
C2 |
F8 |
118.675 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C3 |
H9 |
120.002 |
|
C1 |
C4 |
H10 |
120.002 |
|
C2 |
C5 |
H11 |
120.002 |
|
C2 |
C6 |
H12 |
120.002 |
|
C3 |
C6 |
H12 |
121.322 |
|
C4 |
C5 |
H11 |
121.322 |
|
C5 |
C4 |
H10 |
121.322 |
|
C6 |
C3 |
H9 |
121.322 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.