|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for Na2CO3 (Sodium Carbonate)
1A1 C2V
1910171554
InChI=1S/CH2O3.2Na/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2 INChIKey=CDBYLPFSWZWCQE-UHFFFAOYSA-L
CCD/6-31G
Point group is C2v
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
0.0000 |
0.0000 |
-0.5969 |
|
-0.5969 |
0.0000 |
0.0000 |
| O2 |
0.0000 |
0.0000 |
0.8043 |
|
0.8043 |
0.0000 |
0.0000 |
| O3 |
0.0000 |
1.1628 |
-1.1915 |
|
-1.1915 |
0.0000 |
1.1628 |
| O4 |
0.0000 |
-1.1628 |
-1.1915 |
|
-1.1915 |
0.0000 |
-1.1628 |
| Na5 |
0.0000 |
2.1882 |
0.7368 |
|
0.7368 |
0.0000 |
2.1882 |
| Na6 |
0.0000 |
-2.1882 |
0.7368 |
|
0.7368 |
0.0000 |
-2.1882 |
Atom - Atom Distances (Å)
| |
C1 |
O2 |
O3 |
O4 |
Na5 |
Na6 |
| C1 |
|
1.4012 |
1.3060 |
1.3060 |
2.5626 |
2.5626 |
| O2 |
1.4012 |
| 2.3098 |
2.3098 |
2.1893 |
2.1893 |
| O3 |
1.3060 |
2.3098 |
| 2.3256 |
2.1840 |
3.8662 |
| O4 |
1.3060 |
2.3098 |
2.3256 |
| 3.8662 |
2.1840 |
| Na5 |
2.5626 |
2.1893 |
2.1840 |
3.8662 |
| 4.3764 |
| Na6 |
2.5626 |
2.1893 |
3.8662 |
2.1840 |
4.3764 |
|
Maximum atom distance is 4.3764Å
between atoms Na5 and Na6.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
O2 |
Na5 |
88.234 |
|
C1 |
O2 |
Na6 |
88.234 |
|
C1 |
O3 |
Na5 |
90.920 |
|
C1 |
O4 |
Na6 |
90.920 |
|
O2 |
C1 |
O3 |
117.083 |
|
O2 |
C1 |
O4 |
117.083 |
|
O2 |
Na5 |
O3 |
63.764 |
|
O2 |
Na6 |
O4 |
63.764 |
|
O3 |
C1 |
O4 |
125.835 |
|
Na5 |
O2 |
Na6 |
176.468 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.