|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CH2CHCONH2 (Acrylamide)
1A CS
1910171554
InChI=1S/C3H5NO/c1-2-3(4)5/h2H,1H2,(H2,4,5) INChIKey=HRPVXLWXLXDGHG-UHFFFAOYSA-N
B1B95/6-31G
Point group is C1
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.7933 |
-0.6609 |
-0.0001 |
|
-0.7729 |
0.6847 |
-0.0001 |
| C2 |
0.4713 |
0.1160 |
-0.0000 |
|
0.4676 |
-0.1302 |
-0.0000 |
| N3 |
1.6157 |
-0.6286 |
0.0001 |
|
1.6340 |
0.5793 |
0.0001 |
| O4 |
0.4965 |
1.3637 |
-0.0001 |
|
0.4550 |
-1.3781 |
-0.0001 |
| C5 |
-1.9702 |
-0.0328 |
0.0001 |
|
-1.9683 |
0.0925 |
0.0001 |
| H6 |
-0.7308 |
-1.7458 |
-0.0003 |
|
-0.6775 |
1.7671 |
-0.0003 |
| H7 |
2.4996 |
-0.1481 |
0.0000 |
|
2.5030 |
0.0722 |
0.0000 |
| H8 |
1.6095 |
-1.6331 |
0.0003 |
|
1.6583 |
1.5836 |
0.0003 |
| H9 |
-1.9962 |
1.0521 |
0.0003 |
|
-2.0271 |
-0.9910 |
0.0003 |
| H10 |
-2.9117 |
-0.5682 |
0.0000 |
|
-2.8932 |
0.6562 |
0.0000 |
Atom - Atom Distances (Å)
| |
C1 |
C2 |
N3 |
O4 |
C5 |
H6 |
H7 |
H8 |
H9 |
H10 |
| C1 |
|
1.4842 |
2.4092 |
2.4005 |
1.3340 |
1.0867 |
3.3326 |
2.5920 |
2.0931 |
2.1205 |
| C2 |
1.4842 |
|
1.3653 |
1.2479 |
2.4460 |
2.2161 |
2.0455 |
2.0869 |
2.6390 |
3.4515 |
| N3 |
2.4092 |
1.3653 |
| 2.2851 |
3.6350 |
2.5989 |
1.0061 |
1.0045 |
3.9838 |
4.5279 |
| O4 |
2.4005 |
1.2479 |
2.2851 |
| 2.8346 |
3.3429 |
2.5096 |
3.1968 |
2.5121 |
3.9177 |
| C5 |
1.3340 |
2.4460 |
3.6350 |
2.8346 |
| 2.1143 |
4.4713 |
3.9211 |
1.0852 |
1.0831 |
| H6 |
1.0867 |
2.2161 |
2.5989 |
3.3429 |
2.1143 |
| 3.6039 |
2.3430 |
3.0707 |
2.4786 |
| H7 |
3.3326 |
2.0455 |
1.0061 |
2.5096 |
4.4713 |
3.6039 |
| 1.7314 |
4.6532 |
5.4277 |
| H8 |
2.5920 |
2.0869 |
1.0045 |
3.1968 |
3.9211 |
2.3430 |
1.7314 |
| 4.4957 |
4.6450 |
| H9 |
2.0931 |
2.6390 |
3.9838 |
2.5121 |
1.0852 |
3.0707 |
4.6532 |
4.4957 |
| 1.8610 |
| H10 |
2.1205 |
3.4515 |
4.5279 |
3.9177 |
1.0831 |
2.4786 |
5.4277 |
4.6450 |
1.8610 |
|
Maximum atom distance is 5.4277Å
between atoms H7 and H10.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C2 |
N3 |
115.385 |
|
C1 |
C2 |
O4 |
122.724 |
|
C2 |
C1 |
C5 |
120.346 |
|
N3 |
C2 |
O4 |
121.891 |
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
C1 |
C5 |
H9 |
119.462 |
|
C1 |
C5 |
H10 |
122.288 |
|
C2 |
C1 |
H6 |
118.270 |
|
C2 |
N3 |
H7 |
118.421 |
|
C2 |
N3 |
H8 |
122.696 |
|
C5 |
C1 |
H6 |
121.385 |
|
H7 |
N3 |
H8 |
118.883 |
|
H9 |
C5 |
H10 |
118.250 |
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.