|
Computational Chemistry Comparison and Benchmark DataBase
Release 22 (May 2022) Standard Reference Database 101
National Institute of Standards and Technology
|
|
|
|
You are here: Home > Geometry > Calculated > Calculated geometry OR Calculated > Geometry > Calculated geometry
|
Geometry for CHF2Cl (difluorochloromethane)
1A' CS
1910171554
InChI=1S/CHClF2/c2-1(3)4/h1H INChIKey=VOPWNXZWBYDODV-UHFFFAOYSA-N
HF/6-31G
Point group is Cs
| Atom |
Internal |
|
Principal |
| x (Å) |
y (Å) |
z (Å) |
|
a (Å) |
b (Å) |
c (Å) |
| C1 |
-0.5876 |
-0.0825 |
0.0000 |
|
0.3862 |
-0.4428 |
-0.0825 |
| H2 |
-1.4470 |
0.5499 |
0.0000 |
|
0.9511 |
-1.0905 |
0.5499 |
| Cl3 |
0.9147 |
0.9299 |
0.0000 |
|
-0.6012 |
0.6893 |
0.9299 |
| F4 |
-0.5876 |
-0.8813 |
1.1037 |
|
1.2180 |
0.2826 |
-0.8813 |
| F5 |
-0.5876 |
-0.8813 |
-1.1037 |
|
-0.4456 |
-1.1683 |
-0.8813 |
Atom - Atom Distances (Å)
| |
C1 |
H2 |
Cl3 |
F4 |
F5 |
| C1 |
|
1.0670 |
1.8116 |
1.3624 |
1.3624 |
| H2 |
1.0670 |
| 2.3920 |
2.0012 |
2.0012 |
| Cl3 |
1.8116 |
2.3920 |
| 2.5991 |
2.5991 |
| F4 |
1.3624 |
2.0012 |
2.5991 |
| 2.2074 |
| F5 |
1.3624 |
2.0012 |
2.5991 |
2.2074 |
|
Maximum atom distance is 2.5991Å
between atoms Cl3 and F4.
Calculated Bond Angles (degrees) (Ignoring Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
F3 |
C1 |
F4 |
109.126 |
|
F3 |
C1 |
Cl5 |
109.126 |
|
F4 |
C1 |
Cl5 |
108.211 |
|
Calculated Bond Angles (degrees) (Involving Hydrogens)
| atom1 |
atom2 |
atom3 |
angle |
|
atom1 |
atom2 |
atom3 |
angle |
|
H2 |
C1 |
F3 |
109.677 |
|
H2 |
C1 |
F4 |
110.334 |
|
H2 |
C1 |
Cl5 |
110.334 |
|
For information on specific bond angles or dihedrals
see the geometry comparison page in section
Comparisons > Geometry > Bonds, angles.